missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals DL-Propranolol hydrochloride, 99%
CAS: 318-98-9 | C16H21NO2·HCl | 295.8 g/mol
$1399.50 - $1399.50
Chemical Identifiers
| CAS | 318-98-9 |
|---|---|
| Molecular Formula | C16H21NO2·HCl |
| Molecular Weight (g/mol) | 295.8 |
| MDL Number | MFCD00012558 |
| InChI Key | ZMRUPTIKESYGQW-UHFFFAOYSA-N |
| Synonym | propranolol hydrochloride, propranolol hcl, inderal, avlocardyl, herzbase, inderalici, naprilin, pronovan, dociton, ikopal |
| PubChem CID | 62882 |
| ChEBI | CHEBI:8500 |
| IUPAC Name | 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
| SMILES | CC(C)NCC(COC1=CC=CC2=CC=CC=C21)O.Cl |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC207321000
|
Thermo Scientific Chemicals
207321000 |
100 g | Glass bottle |
Each for $1,399.50
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 318-98-9 | |
| 295.8 | |
| ZMRUPTIKESYGQW-UHFFFAOYSA-N | |
| 62882 | |
| 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
| C16H21NO2·HCl | |
| MFCD00012558 | |
| propranolol hydrochloride, propranolol hcl, inderal, avlocardyl, herzbase, inderalici, naprilin, pronovan, dociton, ikopal | |
| CHEBI:8500 | |
| CC(C)NCC(COC1=CC=CC2=CC=CC=C21)O.Cl |
Specifications
| 318-98-9 | |
| White to Yellow | |
| 99% | |
| C16H21NO2·HCl | |
| MFCD00012558 | |
| 15, 7953 | |
| Solubility in water: soluble. Other solubilities: soluble in alcohol, practically insoluble in ether, benzene and ethyl, acetate | |
| CC(C)NCC(COC1=CC=CC2=CC=CC=C21)O.Cl | |
| 295.8 | |
| CHEBI:8500 | |
| 99% | |
| DL-Propranolol hydrochloride |
| 163.0°C to 166.0°C | |
| Authentic | |
| Glass bottle | |
| C10H7OCH2CH(OH)CH2NHCH(CH3)2·HCl | |
| 100 g | |
| propranolol hydrochloride, propranolol hcl, inderal, avlocardyl, herzbase, inderalici, naprilin, pronovan, dociton, ikopal | |
| ZMRUPTIKESYGQW-UHFFFAOYSA-N | |
| 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride | |
| 62882 | |
| 295.8 | |
| Powder |
Safety and Handling
GHS H Statement
Harmful if swallowed.
GHS P Statement
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
GHS Signal Word: Warning
EINECSNumber : 206-268-7
RUO – Research Use Only