missing translation for 'onlineSavingsMsg'
Learn More
Learn More
DL-Histidine hydrochloride, monohydrate, 98%
CAS: 123333-71-1 | C6H10ClN3O2 | 191.62 g/mol
Supplier: Thermo Scientific Chemicals 411721000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 233.0°C | |
| 98% | |
| 1ppm max. | |
| 10ppm max. | |
| 10ppm max. | |
| 98% | |
| C6H10ClN3O2 | |
| MFCD00064555 | |
| 96% min. (c=3, H2O, 430nm) 1cm cell | |
| hydrogen dl-histidine chloride, 2-amino-3-1h-imidazol-5-yl propanoic acid; hydron; chloride, 2-azanyl-3-1h-imidazol-5-yl propanoic acid; hydron; chloride | |
| [H+].[Cl-].N[C@@H](CC1=CN=CN1)C(O)=O | |
| 191.62 | |
| 53395185 | |
| 98% |
| DL-Histidine hydrochloride, monohydrate | |
| 123333-71-1 | |
| White | |
| Authentic | |
| 1% max. | |
| (TLC) none | |
| Glass Bottle | |
| 300ppm max. | |
| 0.1% max. | |
| QZNNVYOVQUKYSC-JEDNCBNOSA-N | |
| 2-amino-3-(1H-imidazol-5-yl)propanoic acid;hydron;chloride | |
| 100 g | |
| 209.64 | |
| Crystalline Powder |
Chemical Identifiers
| 123333-71-1 | |
| 191.62 | |
| QZNNVYOVQUKYSC-JEDNCBNOSA-N | |
| 53395185 | |
| [H+].[Cl-].N[C@@H](CC1=CN=CN1)C(O)=O |
| C6H10ClN3O2 | |
| MFCD00064555 | |
| hydrogen dl-histidine chloride, 2-amino-3-1h-imidazol-5-yl propanoic acid; hydron; chloride, 2-azanyl-3-1h-imidazol-5-yl propanoic acid; hydron; chloride | |
| 2-amino-3-(1H-imidazol-5-yl)propanoic acid;hydron;chloride |
Safety and Handling
EINECSNumber : 229-266-8
TSCA : TSCA
RUO – Research Use Only