Learn More
DL-10-Camphorsulfonic acid, 98%
CAS: 5872-08-2 | C10H16O4S | 232.29 g/mol
$106.76 - $397.58
Chemical Identifiers
| CAS | 8-2-5872 |
|---|---|
| Molecular Formula | C10H16O4S |
| Molecular Weight (g/mol) | 232.29 |
| MDL Number | MFCD00074827 |
| InChI Key | MIOPJNTWMNEORI-UHFFFAOYNA-N |
| Synonym | reychler's acid, camphorsulfonic acid, d-camphorsulfonic acid, camphersulfosaeure, --10-camphorsulfonic acid, 2-oxobornane-10-sulphonic acid, d-10-camphorsulfonic acid, 7,7-dimethyl-2-oxobicyclo 2.2.1 heptan-1-yl methanesulfonic acid, l-camphor-10-sulfonic acid, +-10-camphorsulfonic acid |
| PubChem CID | 18462 |
| ChEBI | CHEBI:55379 |
| IUPAC Name | (7,7-dimethyl-3-oxo-4-bicyclo[2.2.1]heptanyl)methanesulfonic acid |
| SMILES | CC1(C2CCC1(C(=O)C2)CS(=O)(=O)O)C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC189071000
|
Thermo Scientific Chemicals
189071000 |
100 g | Plastic bottle |
Each for $106.76
|
|
||||
|
AC189075000
|
Thermo Scientific Chemicals
189075000 |
500 g | Plastic bottle |
Each for $397.58
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 8-2-5872 | |
| 232.29 | |
| MIOPJNTWMNEORI-UHFFFAOYNA-N | |
| 18462 | |
| (7,7-dimethyl-3-oxo-4-bicyclo[2.2.1]heptanyl)methanesulfonic acid |
| C10H16O4S | |
| MFCD00074827 | |
| reychler's acid, camphorsulfonic acid, d-camphorsulfonic acid, camphersulfosaeure, --10-camphorsulfonic acid, 2-oxobornane-10-sulphonic acid, d-10-camphorsulfonic acid, 7,7-dimethyl-2-oxobicyclo 2.2.1 heptan-1-yl methanesulfonic acid, l-camphor-10-sulfonic acid, +-10-camphorsulfonic acid | |
| CHEBI:55379 | |
| CC1(C2CCC1(C(=O)C2)CS(=O)(=O)O)C |
Specifications
| 8-2-5872 | |
| >195°C | |
| 1.5% max. (105°C) | |
| 98% | |
| C10H16O4S | |
| 100 g | |
| 14,71; 15,68; 16,58 | |
| Solubility in water: soluble. Other solubilities: slightly soluble in glacial acetic acid,slightly soluble in ethyl acetate,practically insoluble in ether | |
| CC1(C2CCC1(C(=O)C2)CS(=O)(=O)O)C | |
| 232.29 | |
| CHEBI:55379 | |
| 98% | |
| Granular Powder |
| (20% aq. soln.) | |
| Beige | |
| Authentic | |
| Plastic bottle | |
| MFCD00074827 | |
| 11, 316 | |
| reychler's acid, camphorsulfonic acid, d-camphorsulfonic acid, camphersulfosaeure, --10-camphorsulfonic acid, 2-oxobornane-10-sulphonic acid, d-10-camphorsulfonic acid, 7,7-dimethyl-2-oxobicyclo 2.2.1 heptan-1-yl methanesulfonic acid, l-camphor-10-sulfonic acid, +-10-camphorsulfonic acid | |
| MIOPJNTWMNEORI-UHFFFAOYNA-N | |
| (7,7-dimethyl-3-oxo-4-bicyclo[2.2.1]heptanyl)methanesulfonic acid | |
| 18462 | |
| 232.29 | |
| (5% in water) Clear solution | |
| DL-10-Camphorsulfonic acid, 98% |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if pre
GHS Signal Word: Danger
EINECSNumber : 227-527-0
TSCA : TSCA
RUO – Research Use Only