missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Disodium Bathocuproinedisulfonate [for Determination of Cu in Blood], TCI America™
$89.48 - $542.44
Chemical Identifiers
| CAS | 52698-84-7 |
|---|---|
| Molecular Formula | C26H18N2Na2O6S2 |
| Molecular Weight (g/mol) | 564.54 |
| MDL Number | MFCD00149974 |
| InChI Key | RNGKZLRAVYPLJC-UHFFFAOYSA-L |
| Synonym | disodium bathocuproinedisulfonate, sodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate, disodium bathocuproinedisulfonate, bathocuproinedisulfonic acid sodium salt, 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline disulfonate, 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline disulfonate disodium salt, dipotassium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate, disodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate |
| PubChem CID | 15678335 |
| IUPAC Name | disodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate |
| SMILES | [Na+].[Na+].CC1=NC2=C(C=CC3=C2N=C(C)C(=C3C2=CC=CC=C2)S([O-])(=O)=O)C(C2=CC=CC=C2)=C1S([O-])(=O)=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
B0985100MG
|
TCI America
B0985100MG |
100 mg |
Each for $89.48
|
|
|||||
|
B09851G
|
TCI America
B09851G |
1 g |
Each for $542.44
|
|
|||||
Chemical Identifiers
| 52698-84-7 | |
| 564.54 | |
| RNGKZLRAVYPLJC-UHFFFAOYSA-L | |
| 15678335 | |
| [Na+].[Na+].CC1=NC2=C(C=CC3=C2N=C(C)C(=C3C2=CC=CC=C2)S([O-])(=O)=O)C(C2=CC=CC=C2)=C1S([O-])(=O)=O |
| C26H18N2Na2O6S2 | |
| MFCD00149974 | |
| disodium bathocuproinedisulfonate, sodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate, disodium bathocuproinedisulfonate, bathocuproinedisulfonic acid sodium salt, 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline disulfonate, 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline disulfonate disodium salt, dipotassium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate, disodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate | |
| disodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate |
Specifications
| 52698-84-7 | |
| MFCD00149974 | |
| disodium bathocuproinedisulfonate, sodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate, disodium bathocuproinedisulfonate, bathocuproinedisulfonic acid sodium salt, 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline disulfonate, 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline disulfonate disodium salt, dipotassium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate, disodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate | |
| [Na+].[Na+].CC1=NC2=C(C=CC3=C2N=C(C)C(=C3C2=CC=CC=C2)S([O-])(=O)=O)C(C2=CC=CC=C2)=C1S([O-])(=O)=O | |
| 564.54 | |
| 564.54 | |
| Disodium Bathocuproinedisulfonate [for Determination of Cu in Blood] |
| C26H18N2Na2O6S2 | |
| 100 mg | |
| RNGKZLRAVYPLJC-UHFFFAOYSA-L | |
| disodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate | |
| 15678335 | |
| Crystalline Powder |
Safety and Handling
TSCA : Yes