Learn More
Diphenylacetylene, 99%
CAS: 501-65-5 | C14H10 | 178.234 g/mol
$65.32 - $474.86
Chemical Identifiers
| CAS | 501-65-5 |
|---|---|
| Molecular Formula | C14H10 |
| Molecular Weight (g/mol) | 178.234 |
| MDL Number | MFCD00004786 |
| InChI Key | JRXXLCKWQFKACW-UHFFFAOYSA-N |
| Synonym | diphenylacetylene, tolan, diphenylethyne, 1,2-diphenylethyne, tolane, 1,2-diphenylacetylene, benzene, 1,1'-1,2-ethynediyl bis, biphenylacetylene, diphenyl acetylene, ethyne, diphenyl |
| PubChem CID | 10390 |
| ChEBI | CHEBI:51579 |
| IUPAC Name | 2-phenylethynylbenzene |
| SMILES | C1=CC=C(C=C1)C#CC2=CC=CC=C2 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAA1397906
|
Thermo Scientific Chemicals
A1397906 |
5 g |
Each for $65.32
|
|
|||||
|
AAA1397914
|
Thermo Scientific Chemicals
A1397914 |
25 g |
Each for $141.22
|
|
|||||
|
AAA1397922
|
Thermo Scientific Chemicals
A1397922 |
100 g |
Each for $474.86
|
|
|||||
Description
Diphenylacetylene is often used as a building block in organic and organometallic chemistry. It acts as dienophile and under goes Diels-Alder reaction with tetraphenylcyclopentadienone to prepare hexaphenylbenzene. It acts as a precursor in the preparation of 3-alkoxycyclopropene by reacting with benzal chloride in the presence of potassium t-butoxide.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
ApplicationsDiphenylacetylene is often used as a building block in organic and organometallic chemistry. It acts as dienophile and under goes Diels-Alder reaction with tetraphenylcyclopentadienone to prepare hexaphenylbenzene. It acts as a precursor in the preparation of 3-alkoxycyclopropene by reacting with benzal chloride in the presence of potassium t-butoxide.
Solubility
Miscible with ether and hot alcohol. Immiscible with water.
Notes
Incompatible with strong oxidizing agents.
Chemical Identifiers
| 501-65-5 | |
| 178.234 | |
| JRXXLCKWQFKACW-UHFFFAOYSA-N | |
| 10390 | |
| 2-phenylethynylbenzene |
| C14H10 | |
| MFCD00004786 | |
| diphenylacetylene, tolan, diphenylethyne, 1,2-diphenylethyne, tolane, 1,2-diphenylacetylene, benzene, 1,1'-1,2-ethynediyl bis, biphenylacetylene, diphenyl acetylene, ethyne, diphenyl | |
| CHEBI:51579 | |
| C1=CC=C(C=C1)C#CC2=CC=CC=C2 |
Specifications
| 501-65-5 | |
| 0.99 | |
| Odorless | |
| MFCD00004786 | |
| 606478 | |
| diphenylacetylene, tolan, diphenylethyne, 1,2-diphenylethyne, tolane, 1,2-diphenylacetylene, benzene, 1,1'-1,2-ethynediyl bis, biphenylacetylene, diphenyl acetylene, ethyne, diphenyl | |
| JRXXLCKWQFKACW-UHFFFAOYSA-N | |
| 2-phenylethynylbenzene | |
| 10390 | |
| 178.23 | |
| Diphenylacetylene |
| 58°C to 62°C | |
| 170°C (19 mmHg) | |
| C14H10 | |
| 5 g | |
| 14,9504 | |
| Miscible with ether and hot alcohol. Immiscible with water. | |
| C1=CC=C(C=C1)C#CC2=CC=CC=C2 | |
| 178.234 | |
| CHEBI:51579 | |
| 99% |
Safety and Handling
EINECSNumber : 207-926-6
TSCA : Yes
Recommended Storage : Keep cold
RUO – Research Use Only