missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Diphenylacetylene, 99%
CAS: 501-65-5 | C14H10 | 178.23 g/mol
Supplier: Thermo Scientific Chemicals 117180250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Diphenylacetylene | |
| 58.0°C to 61.0°C | |
| 0.9900g/mL | |
| Authentic | |
| Glass bottle | |
| C6H5C≡CC6H5 | |
| 05,656 | |
| 0.99 | |
| diphenylacetylene, tolan, diphenylethyne, 1,2-diphenylethyne, tolane, 1,2-diphenylacetylene, benzene, 1,1'-1,2-ethynediyl bis, biphenylacetylene, diphenyl acetylene, ethyne, diphenyl | |
| JRXXLCKWQFKACW-UHFFFAOYSA-N | |
| 2-phenylethynylbenzene | |
| 10390 | |
| 178.23 | |
| Crystalline Powder and/or Chunks |
| 501-65-5 | |
| Brown to Yellow | |
| 170.0°C (19.0 mmHg) | |
| 98.5% min. (GC) | |
| C14H10 | |
| 25 g | |
| 01,335 | |
| 15,9664 | |
| Solubility in water: insoluble. Other solubilities: soluble in ether and hot alcohol | |
| C1=CC=C(C=C1)C#CC2=CC=CC=C2 | |
| 178.23 | |
| CHEBI:51579 | |
| 99% |
Chemical Identifiers
| 501-65-5 | |
| 178.23 | |
| diphenylacetylene, tolan, diphenylethyne, 1,2-diphenylethyne, tolane, 1,2-diphenylacetylene, benzene, 1,1'-1,2-ethynediyl bis, biphenylacetylene, diphenyl acetylene, ethyne, diphenyl | |
| CHEBI:51579 | |
| C1=CC=C(C=C1)C#CC2=CC=CC=C2 |
| C14H10 | |
| JRXXLCKWQFKACW-UHFFFAOYSA-N | |
| 10390 | |
| 2-phenylethynylbenzene |
Safety and Handling
EINECSNumber : 207-926-6
RUO – Research Use Only