missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Diphenyl phosphate, 99%
CAS: 838-85-7 | C12H11O4P | 250.19 g/mol
$83.23 - $83.23
Chemical Identifiers
| CAS | 838-85-7 |
|---|---|
| Molecular Formula | C12H11O4P |
| Molecular Weight (g/mol) | 250.19 |
| MDL Number | MFCD00003033 |
| InChI Key | ASMQGLCHMVWBQR-UHFFFAOYSA-N |
| Synonym | diphenyl phosphate, phosphoric acid, diphenyl ester, phenyl hydrogen phosphate, phenyl phosphate pho 2 ho po, diphenoxyphosphinic acid, phosphoric acid diphenyl ester, diphenylphosphoric acid, phosphoric acid diphenyl, dsstox_cid_28182 |
| PubChem CID | 13282 |
| IUPAC Name | diphenyl hydrogen phosphate |
| SMILES | OP(=O)(OC1=CC=CC=C1)OC1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC225690050
|
Thermo Scientific Chemicals
225690050 |
5 g | Glass bottle |
Each for $83.23
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 838-85-7 | |
| 250.19 | |
| ASMQGLCHMVWBQR-UHFFFAOYSA-N | |
| 13282 | |
| OP(=O)(OC1=CC=CC=C1)OC1=CC=CC=C1 |
| C12H11O4P | |
| MFCD00003033 | |
| diphenyl phosphate, phosphoric acid, diphenyl ester, phenyl hydrogen phosphate, phenyl phosphate pho 2 ho po, diphenoxyphosphinic acid, phosphoric acid diphenyl ester, diphenylphosphoric acid, phosphoric acid diphenyl, dsstox_cid_28182 | |
| diphenyl hydrogen phosphate |
Specifications
| 838-85-7 | |
| White | |
| 99% | |
| C12H11O4P | |
| MFCD00003033 | |
| 06, 178 | |
| ASMQGLCHMVWBQR-UHFFFAOYSA-N | |
| diphenyl hydrogen phosphate | |
| 13282 | |
| 99% | |
| Diphenyl phosphate, 99% |
| 63°C to 70°C | |
| Authentic | |
| Glass bottle | |
| (C6H5O)2P(O)OH | |
| 5 g | |
| diphenyl phosphate, phosphoric acid, diphenyl ester, phenyl hydrogen phosphate, phenyl phosphate pho 2 ho po, diphenoxyphosphinic acid, phosphoric acid diphenyl ester, diphenylphosphoric acid, phosphoric acid diphenyl, dsstox_cid_28182 | |
| OP(=O)(OC1=CC=CC=C1)OC1=CC=CC=C1 | |
| 250.19 | |
| 250.19 | |
| Crystalline Powder |
Safety and Handling
EINECSNumber : 212-657-2
RTECSNumber : TC5470000
TSCA : TSCA
RUO – Research Use Only