Learn More
Dioctyl sulfosuccinate, sodium salt, 96%
CAS: 577-11-7 | C20H37NaO7S | 444.56 g/mol
$89.29 - $534.08
Chemical Identifiers
| CAS | 577-11-7 |
|---|---|
| Molecular Formula | C20H37NaO7S |
| Molecular Weight (g/mol) | 444.56 |
| MDL Number | MFCD00012455 |
| InChI Key | APSBXTVYXVQYAB-UHFFFAOYNA-M |
| Synonym | docusate sodium, dioctyl sodium sulfosuccinate, aerosol ot, constonate, diox, manoxol ot, diomedicone, clestol, complemix, defilin |
| PubChem CID | 23673837 |
| IUPAC Name | sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate |
| SMILES | [Na+].CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S([O-])(=O)=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC117101000
|
Thermo Scientific Chemicals
117101000 |
100 g | Plastic Bottle |
Each for $89.29
|
|
||||
|
AC117100010
|
Thermo Scientific Chemicals
117100010 |
1 kg | Plastic Bottle |
Each for $331.16
|
|
||||
|
AC117100025
|
Thermo Scientific Chemicals
117100025 |
2.5 kg | Plastic drum |
Each for $534.08
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 577-11-7 | |
| 444.56 | |
| APSBXTVYXVQYAB-UHFFFAOYNA-M | |
| 23673837 | |
| [Na+].CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S([O-])(=O)=O |
| C20H37NaO7S | |
| MFCD00012455 | |
| docusate sodium, dioctyl sodium sulfosuccinate, aerosol ot, constonate, diox, manoxol ot, diomedicone, clestol, complemix, defilin | |
| sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate |
Specifications
| 2.5 max. (on solids basis) | |
| White | |
| 96% | |
| C20H37NaO7S | |
| 100 g | |
| 15,149 | |
| docusate sodium, dioctyl sodium sulfosuccinate, aerosol ot, constonate, diox, manoxol ot, diomedicone, clestol, complemix, defilin | |
| APSBXTVYXVQYAB-UHFFFAOYNA-M | |
| sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate | |
| 23673837 | |
| ≥95% | |
| Dioctyl sulfosuccinate, sodium salt |
| 577-11-7 | |
| Authentic | |
| Plastic Bottle | |
| MFCD00012455 | |
| 04, IV, 114 | |
| 15, 3446 | |
| 300ppm max. Insoluble Matter (in toluene, in 50% soln.) | |
| [Na+].CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S([O-])(=O)=O | |
| 444.56 | |
| 444.55 | |
| Waxy Solid |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye damage.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/e
GHS Signal Word: Danger
EINECSNumber : 209-406-4
RUO – Research Use Only