Learn More
Diisobutylamine, 99%
CAS: 110-96-3 | C8H20N | 130.25 g/mol
$95.12 - $95.12
Chemical Identifiers
| CAS | 110-96-3 |
|---|---|
| Molecular Formula | C8H20N |
| Molecular Weight (g/mol) | 130.25 |
| MDL Number | MFCD00008930 |
| InChI Key | OBYVIBDTOCAXSN-OCAPTIKFSA-O |
| Synonym | diisobutylamine, 1-propanamine, 2-methyl-n-2-methylpropyl, bis 2-methylpropyl amine, amine, diisobutyl, bis beta-methylpropyl amine, di-isobutylamine, n,n-bis 2-methylpropyl amine, unii-t18y0a819s, ccris 6232, di-2-methylpropyl amine |
| PubChem CID | 8085 |
| IUPAC Name | 2-methyl-N-(2-methylpropyl)propan-1-amine |
| SMILES | CC[C@H](C)[NH2+][C@H](C)CC |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC159075000
|
Thermo Scientific Chemicals
159075000 |
500 mL |
Each for $95.12
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 110-96-3 | |
| 130.25 | |
| OBYVIBDTOCAXSN-OCAPTIKFSA-O | |
| 8085 | |
| CC[C@H](C)[NH2+][C@H](C)CC |
| C8H20N | |
| MFCD00008930 | |
| diisobutylamine, 1-propanamine, 2-methyl-n-2-methylpropyl, bis 2-methylpropyl amine, amine, diisobutyl, bis beta-methylpropyl amine, di-isobutylamine, n,n-bis 2-methylpropyl amine, unii-t18y0a819s, ccris 6232, di-2-methylpropyl amine | |
| 2-methyl-N-(2-methylpropyl)propan-1-amine |
Specifications
| 110-96-3 | |
| 0.7400g/mL | |
| 26°C | |
| 98.5% min. (GC) | |
| C8H20N | |
| [(CH3)2CHCH2]2NH | |
| 500 mL | |
| 0.74 | |
| Solubility in water: 5g/L water (20°C) | |
| CC[C@H](C)[NH2+][C@H](C)CC | |
| 130.25 | |
| 0.8 mPa.s (20°C) | |
| 99% | |
| Diisobutylamine |
| -77°C | |
| 137°C to 139°C | |
| Authentic | |
| Glass bottle | |
| 1.4071 to 1.4091 | |
| MFCD00008930 | |
| 04, 166 | |
| diisobutylamine, 1-propanamine, 2-methyl-n-2-methylpropyl, bis 2-methylpropyl amine, amine, diisobutyl, bis beta-methylpropyl amine, di-isobutylamine, n,n-bis 2-methylpropyl amine, unii-t18y0a819s, ccris 6232, di-2-methylpropyl amine | |
| OBYVIBDTOCAXSN-OCAPTIKFSA-O | |
| 2-methyl-N-(2-methylpropyl)propan-1-amine | |
| 8085 | |
| 129.24 | |
| Liquid |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
Toxic if swallowed.
Flammable liquid and vapour.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Wear eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsi
GHS Signal Word: Danger
EINECSNumber : 203-819-3
RUO – Research Use Only