missing translation for 'onlineSavingsMsg'
Learn More
Learn More
MilliporeSigma™ Dihydrorhodamine 123, Calbiochem™,
Cell-permeable fluorogenic probe that is useful for the detection of reactive oxygen species (ROS) such as peroxide and peroxynitrite
Supplier: MilliporeSigma™ 3098255MG
Specifications
| Dihydrorhodamine 123 | |
| Pink-White | |
| C21H18N2O3 | |
| MFCD04221428 | |
| dihydrorhodamine 123, dihydrorhodamine, methyl 2-3,6-diamino-9h-xanthen-9-yl benzoate, benzoic acid, 2-3,6-diamino-9h-xanthen-9-yl-, methyl ester, dihydrorhodamine-123 | |
| COC(=O)C1=CC=CC=C1C1C2=CC=C(N)C=C2OC2=CC(N)=CC=C12 | |
| 346.39 | |
| 346.4 | |
| ≥95% | |
| Solid |
| 109244-58-8 | |
| 14 (aq. soln.) | |
| 1.37 (20°C, 589nm) | |
| 5 mg | |
| FNEZBBILNYNQGC-UHFFFAOYSA-N | |
| methyl 2-(3,6-diamino-9H-xanthen-9-yl)benzoate | |
| 105032 | |
| 263 hPa (20°C) | |
| HPLC |
Chemical Identifiers
| 109244-58-8 | |
| 346.39 | |
| FNEZBBILNYNQGC-UHFFFAOYSA-N | |
| 105032 | |
| COC(=O)C1=CC=CC=C1C1C2=CC=C(N)C=C2OC2=CC(N)=CC=C12 |
| C21H18N2O3 | |
| MFCD04221428 | |
| dihydrorhodamine 123, dihydrorhodamine, methyl 2-3,6-diamino-9h-xanthen-9-yl benzoate, benzoic acid, 2-3,6-diamino-9h-xanthen-9-yl-, methyl ester, dihydrorhodamine-123 | |
| methyl 2-(3,6-diamino-9H-xanthen-9-yl)benzoate |
Safety and Handling
Recommended Storage : -20°C (-4°F); Keep container tightly closed. Keep container in a cool, well-ventilated area. Do not store above -20°C (-4°F).