missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Diethyl phenylmalonate, 98%
CAS: 83-13-6 | C13H16O4 | 236.27 g/mol
$106.26 - $106.26
Chemical Identifiers
| CAS | 83-13-6 |
|---|---|
| MDL Number | MFCD00009144 |
| InChI Key | FGYDHYCFHBSNPE-UHFFFAOYSA-N |
| Synonym | diethyl phenylmalonate, diethyl 2-phenylmalonate, phenylmalonic acid diethyl ester, propanedioic acid, phenyl-, diethyl ester, diethylphenylmalonate, 1,3-diethyl 2-phenylpropanedioate, malonic acid, phenyl-, diethyl ester, propanedioic acid, 2-phenyl-, 1,3-diethyl ester, diethyl 2-phenylpropane-1,3-dioate, diethyl-phenylmalonate |
| PubChem CID | 66514 |
| IUPAC Name | diethyl 2-phenylpropanedioate |
| SMILES | CCOC(=O)C(C1=CC=CC=C1)C(=O)OCC |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC150262500
|
Thermo Scientific Chemicals
150262500 |
250 mL | Glass bottle |
Each for $106.26
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 83-13-6 | |
| FGYDHYCFHBSNPE-UHFFFAOYSA-N | |
| 66514 | |
| CCOC(=O)C(C1=CC=CC=C1)C(=O)OCC |
| MFCD00009144 | |
| diethyl phenylmalonate, diethyl 2-phenylmalonate, phenylmalonic acid diethyl ester, propanedioic acid, phenyl-, diethyl ester, diethylphenylmalonate, 1,3-diethyl 2-phenylpropanedioate, malonic acid, phenyl-, diethyl ester, propanedioic acid, 2-phenyl-, 1,3-diethyl ester, diethyl 2-phenylpropane-1,3-dioate, diethyl-phenylmalonate | |
| diethyl 2-phenylpropanedioate |
Specifications
| 83-13-6 | |
| Colorless to Yellow | |
| 170.0°C to 172.0°C (14.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4903 to 1.4923 | |
| MFCD00009144 | |
| 09, 854 | |
| diethyl phenylmalonate, diethyl 2-phenylmalonate, phenylmalonic acid diethyl ester, propanedioic acid, phenyl-, diethyl ester, diethylphenylmalonate, 1,3-diethyl 2-phenylpropanedioate, malonic acid, phenyl-, diethyl ester, propanedioic acid, 2-phenyl-, 1,3-diethyl ester, diethyl 2-phenylpropane-1,3-dioate, diethyl-phenylmalonate | |
| FGYDHYCFHBSNPE-UHFFFAOYSA-N | |
| diethyl 2-phenylpropanedioate | |
| 66514 | |
| 98% | |
| Diethyl phenylmalonate |
| 16.0°C to 17.0°C | |
| 1.0900g/mL | |
| >112°C | |
| 97.5% min. (GC) | |
| C13H16O4 | |
| C2H5O2CCH(C6H5)CO2C2H5 | |
| 250 mL | |
| 1.09 | |
| Solubility in water: immiscible | |
| CCOC(=O)C(C1=CC=CC=C1)C(=O)OCC | |
| 236.27 | |
| 236.27 | |
| Liquid After Melting |
Safety and Handling
EINECSNumber : 201-456-5
RUO – Research Use Only