missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Diethyl diethylmalonate, 98%
CAS: 77-25-8 | C11H20O4 | 216.277 g/mol
$85.78 - $905.60
Chemical Identifiers
| CAS | 77-25-8 |
|---|---|
| Molecular Formula | C11H20O4 |
| Molecular Weight (g/mol) | 216.277 |
| MDL Number | MFCD00009132 |
| InChI Key | ZKBBUZRGPULIRN-UHFFFAOYSA-N |
| Synonym | diethyl diethylmalonate, diethyl 2,2-diethylmalonate, diethylmalonic ester, propanedioic acid, diethyl-, diethyl ester, diethylmalonate diethyl ester, diethylmalonic acid diethyl ester, diethylmalonic acid, diethyl ester, unii-ceh13944yq, 1,3-diethyl 2,2-diethylpropanedioate, diethyl diethylmalonate diethyl |
| PubChem CID | 66165 |
| IUPAC Name | diethyl 2,2-diethylpropanedioate |
| SMILES | CCC(CC)(C(=O)OCC)C(=O)OCC |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAB2381014
|
Thermo Scientific Chemicals
B2381014 |
25 g |
Each for $85.78
|
|
|||||
|
AAB2381022
|
Thermo Scientific Chemicals
B2381022 |
100 g |
Each for $222.42
|
|
|||||
|
AAB2381036
|
Thermo Scientific Chemicals
B2381036 |
500 g |
Each for $905.60
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 77-25-8 | |
| 216.277 | |
| ZKBBUZRGPULIRN-UHFFFAOYSA-N | |
| 66165 | |
| CCC(CC)(C(=O)OCC)C(=O)OCC |
| C11H20O4 | |
| MFCD00009132 | |
| diethyl diethylmalonate, diethyl 2,2-diethylmalonate, diethylmalonic ester, propanedioic acid, diethyl-, diethyl ester, diethylmalonate diethyl ester, diethylmalonic acid diethyl ester, diethylmalonic acid, diethyl ester, unii-ceh13944yq, 1,3-diethyl 2,2-diethylpropanedioate, diethyl diethylmalonate diethyl | |
| diethyl 2,2-diethylpropanedioate |
Specifications
| 77-25-8 | |
| 228°C to 230°C | |
| C11H20O4 | |
| MFCD00009132 | |
| 14,3789 | |
| ZKBBUZRGPULIRN-UHFFFAOYSA-N | |
| diethyl 2,2-diethylpropanedioate | |
| 66165 | |
| 98% |
| 0.99 | |
| 94°C (202°F) | |
| 1.423 | |
| 25 g | |
| diethyl diethylmalonate, diethyl 2,2-diethylmalonate, diethylmalonic ester, propanedioic acid, diethyl-, diethyl ester, diethylmalonate diethyl ester, diethylmalonic acid diethyl ester, diethylmalonic acid, diethyl ester, unii-ceh13944yq, 1,3-diethyl 2,2-diethylpropanedioate, diethyl diethylmalonate diethyl | |
| CCC(CC)(C(=O)OCC)C(=O)OCC | |
| 216.277 | |
| 216.28 | |
| Diethyl diethylmalonate |
Safety and Handling
EINECSNumber : 201-016-2
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only