missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Diethyl bis(hydroxymethyl)malonate, 95%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 189535000
| Quantity | 500g |
|---|---|
| Packaging | Glass Bottle |
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 20605-01-0 | |
| 220.22 | |
| WIOHBOKEUIHYIC-UHFFFAOYSA-N | |
| 311844 | |
| CCOC(=O)C(CO)(CO)C(=O)OCC |
| C9H16O6 | |
| MFCD00009130 | |
| diethyl bis hydroxymethyl malonate, diethyl 2,2-bis hydroxymethyl malonate, propanedioic acid, bis hydroxymethyl-, diethyl ester, 1,3-diethyl 2,2-bis hydroxymethyl propanedioate, diethyl 2,2-bis hydroxymethyl propanedioate, 2,2-bis hydroxymethyl malonic acid diethyl ester, bis hydroxymethyl malonic acid diethyl ester, diethyl 2,2-bis hydroxymethyl propane-1,3-dioate, acmc-20al8x, ksc490a8h | |
| diethyl 2,2-bis(hydroxymethyl)propanedioate |
Specifications
| Diethyl bis(hydroxymethyl)malonate | |
| >110°C | |
| 95% | |
| C9H16O6 | |
| 500g | |
| diethyl bis hydroxymethyl malonate, diethyl 2,2-bis hydroxymethyl malonate, propanedioic acid, bis hydroxymethyl-, diethyl ester, 1,3-diethyl 2,2-bis hydroxymethyl propanedioate, diethyl 2,2-bis hydroxymethyl propanedioate, 2,2-bis hydroxymethyl malonic acid diethyl ester, bis hydroxymethyl malonic acid diethyl ester, diethyl 2,2-bis hydroxymethyl propane-1,3-dioate, acmc-20al8x, ksc490a8h | |
| CCOC(=O)C(CO)(CO)C(=O)OCC | |
| 220.22 | |
| 220.22 |
| 20605-01-0 | |
| Authentic | |
| Glass Bottle | |
| (HOCH2)2C(CO2C2H5)2 | |
| MFCD00009130 | |
| WIOHBOKEUIHYIC-UHFFFAOYSA-N | |
| diethyl 2,2-bis(hydroxymethyl)propanedioate | |
| 311844 | |
| 95% |
Safety and Handling
GHS H Statement
Causes skin irritation.
GHS Signal Word: Warning
EINECSNumber : 243-916-8