missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Dibutyl sebacate, 93%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 406650025
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Dibutyl sebacate | |
| 0.9400g/mL | |
| Authentic | |
| Glass bottle | |
| CH3(CH2)3OCO(CH2)8COO(CH2)3CH3 | |
| MFCD00027218 | |
| 0.94 | |
| PYGXAGIECVVIOZ-UHFFFAOYSA-N | |
| dibutyl decanedioate | |
| 7986 | |
| 93% |
| 109-43-3 | |
| 167°C | |
| 91% min. (GC) | |
| C18H34O4 | |
| 1.4400 to 1.442 | |
| 2.5kg | |
| dibutyl sebacate, butyl sebacate, di-n-butyl sebacate, decanedioic acid, dibutyl ester, polycizer dbs, kodaflex dbs, dibutyl sebacinate, staflex dbs, sebacic acid, dibutyl ester, monoplex dbs | |
| CCCCOC(=O)CCCCCCCCC(=O)OCCCC | |
| 314.46 | |
| 314.46 |
Chemical Identifiers
| 109-43-3 | |
| 314.46 | |
| PYGXAGIECVVIOZ-UHFFFAOYSA-N | |
| 7986 | |
| CCCCOC(=O)CCCCCCCCC(=O)OCCCC |
| C18H34O4 | |
| MFCD00027218 | |
| dibutyl sebacate, butyl sebacate, di-n-butyl sebacate, decanedioic acid, dibutyl ester, polycizer dbs, kodaflex dbs, dibutyl sebacinate, staflex dbs, sebacic acid, dibutyl ester, monoplex dbs | |
| dibutyl decanedioate |
Safety and Handling
EINECSNumber : 203-672-5
RUO â Research Use Only