missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Dibutyl sebacate, 93%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 406650025
| Quantity | 2.5kg |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| C18H34O4 | |
| MFCD00027218 | |
| dibutyl sebacate, butyl sebacate, di-n-butyl sebacate, decanedioic acid, dibutyl ester, polycizer dbs, kodaflex dbs, dibutyl sebacinate, staflex dbs, sebacic acid, dibutyl ester, monoplex dbs | |
| dibutyl decanedioate |
Specifications
| Dibutyl sebacate | |
| 0.9400g/mL | |
| Authentic | |
| Glass bottle | |
| 1.4400 to 1.442 | |
| 2.5kg | |
| 0.94 | |
| PYGXAGIECVVIOZ-UHFFFAOYSA-N | |
| dibutyl decanedioate | |
| 7986 | |
| 93% |
| 109-43-3 | |
| 167°C | |
| 91% min. (GC) | |
| C18H34O4 | |
| CH3(CH2)3OCO(CH2)8COO(CH2)3CH3 | |
| MFCD00027218 | |
| dibutyl sebacate, butyl sebacate, di-n-butyl sebacate, decanedioic acid, dibutyl ester, polycizer dbs, kodaflex dbs, dibutyl sebacinate, staflex dbs, sebacic acid, dibutyl ester, monoplex dbs | |
| CCCCOC(=O)CCCCCCCCC(=O)OCCCC | |
| 314.46 | |
| 314.46 |
Safety and Handling
EINECSNumber : 203-672-5