missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Dibromofluorescein (contains Mono-, Tri- and Tetra-), TCI America™
Supplier: TCI America D11205G
Specifications
| Dibromofluorescein (contains Mono-, Tri- and Tetra-) | |
| C20H10Br2O5 | |
| 5 g | |
| ZDTNHRWWURISAA-UHFFFAOYSA-N | |
| 4',5'-dibromo-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one | |
| 11689 | |
| Crystalline Powder |
| 596-03-2 | |
| MFCD00005042 | |
| 4',5'-dibromofluorescein, solvent red 72, eosinic acid, japan orange 201, d&c orange no. 5, c.i. solvent red 72, 4',5'-dibromofluororescein, 4,5-dibromofluorescein, d & c orange no. 5, japan orange no. 201 | |
| C1=CC=C2C(=C1)C(=O)OC23C4=C(C(=C(C=C4)O)Br)OC5=C3C=CC(=C5Br)O | |
| 490.103 | |
| 490.10 |
Chemical Identifiers
| 596-03-2 | |
| 490.103 | |
| ZDTNHRWWURISAA-UHFFFAOYSA-N | |
| 11689 | |
| C1=CC=C2C(=C1)C(=O)OC23C4=C(C(=C(C=C4)O)Br)OC5=C3C=CC(=C5Br)O |
| C20H10Br2O5 | |
| MFCD00005042 | |
| 4',5'-dibromofluorescein, solvent red 72, eosinic acid, japan orange 201, d&c orange no. 5, c.i. solvent red 72, 4',5'-dibromofluororescein, 4,5-dibromofluorescein, d & c orange no. 5, japan orange no. 201 | |
| 4',5'-dibromo-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
Safety and Handling
EINECSNumber : (5)-4271
RTECSNumber : LM5200000
TSCA : Yes