missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Dibenzyl Carbonate 98.0+%, TCI America™
$43.78 - $136.03
Chemical Identifiers
| CAS | 3459-92-5 |
|---|---|
| Molecular Formula | C15H14O3 |
| Molecular Weight (g/mol) | 242.274 |
| MDL Number | MFCD00014436 |
| InChI Key | PIZLBWGMERQCOC-UHFFFAOYSA-N |
| Synonym | acmc-209i8r, benzyl carbonate, carbonic acid dibenzyl ester, carbonic acid, bis phenylmethyl ester, carbonic acid, dibenzyl ester, carbonic acid,bis phenylmethyl ester, dibenzyl carbonate, dibenzylcarbonate, phenylmethyl phenylmethoxy formate |
| PubChem CID | 77002 |
| IUPAC Name | dibenzyl carbonate |
| SMILES | C1=CC=C(C=C1)COC(=O)OCC2=CC=CC=C2 |
Chemical Identifiers
| 3459-92-5 | |
| 242.274 | |
| PIZLBWGMERQCOC-UHFFFAOYSA-N | |
| 77002 | |
| C1=CC=C(C=C1)COC(=O)OCC2=CC=CC=C2 |
| C15H14O3 | |
| MFCD00014436 | |
| acmc-209i8r, benzyl carbonate, carbonic acid dibenzyl ester, carbonic acid, bis phenylmethyl ester, carbonic acid, dibenzyl ester, carbonic acid,bis phenylmethyl ester, dibenzyl carbonate, dibenzylcarbonate, phenylmethyl phenylmethoxy formate | |
| dibenzyl carbonate |
Specifications
| White-Yellow | |
| 3459-92-5 | |
| MFCD00014436 | |
| PIZLBWGMERQCOC-UHFFFAOYSA-N | |
| dibenzyl carbonate | |
| 77002 | |
| Crystal at 20°C | |
| Dibenzyl Carbonate |
| 1g | |
| C15H14O3 | |
| acmc-209i8r, benzyl carbonate, carbonic acid dibenzyl ester, carbonic acid, bis phenylmethyl ester, carbonic acid, dibenzyl ester, carbonic acid,bis phenylmethyl ester, dibenzyl carbonate, dibenzylcarbonate, phenylmethyl phenylmethoxy formate | |
| C1=CC=C(C=C1)COC(=O)OCC2=CC=CC=C2 | |
| 242.274 | |
| 242.27 | |
| ≥98.0% (GC) |
Safety and Handling
TSCA : Yes