missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Dibenzoylmethane, 98%
CAS: 120-46-7 | C15H12O2 | 224.26 g/mol
$60.03 - $60.03
Chemical Identifiers
| CAS | 120-46-7 |
|---|---|
| Molecular Formula | C15H12O2 |
| Molecular Weight (g/mol) | 224.26 |
| MDL Number | MFCD00003085 |
| InChI Key | NZZIMKJIVMHWJC-UHFFFAOYSA-N |
| Synonym | dibenzoylmethane, 1,3-diphenyl-1,3-propanedione, 2-benzoylacetophenone, phenyl phenacyl ketone, 1,3-propanedione, 1,3-diphenyl, rhodiastab 83, omega-benzoylacetophenone, dibenzoyl-methane, karenzu dk2, unii-ans7me8okc |
| PubChem CID | 8433 |
| ChEBI | CHEBI:75417 |
| IUPAC Name | 1,3-diphenylpropane-1,3-dione |
| SMILES | C1=CC=C(C=C1)C(=O)CC(=O)C2=CC=CC=C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC112600100
|
Thermo Scientific Chemicals
112600100 |
10 g | Glass Bottle |
Each for $60.03
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 120-46-7 | |
| 224.26 | |
| NZZIMKJIVMHWJC-UHFFFAOYSA-N | |
| 8433 | |
| 1,3-diphenylpropane-1,3-dione |
| C15H12O2 | |
| MFCD00003085 | |
| dibenzoylmethane, 1,3-diphenyl-1,3-propanedione, 2-benzoylacetophenone, phenyl phenacyl ketone, 1,3-propanedione, 1,3-diphenyl, rhodiastab 83, omega-benzoylacetophenone, dibenzoyl-methane, karenzu dk2, unii-ans7me8okc | |
| CHEBI:75417 | |
| C1=CC=C(C=C1)C(=O)CC(=O)C2=CC=CC=C2 |
Specifications
| 120-46-7 | |
| Yellow | |
| Authentic | |
| Glass Bottle | |
| C6H5COCH2COC6H5 | |
| 10 g | |
| 15,3014 | |
| NZZIMKJIVMHWJC-UHFFFAOYSA-N | |
| 1,3-diphenylpropane-1,3-dione | |
| 8433 | |
| 224.26 | |
| Crystals |
| 75°C to 79°C | |
| 219°C to 221°C (18.0 mmHg) | |
| 98% | |
| C15H12O2 | |
| MFCD00003085 | |
| 07,769 | |
| dibenzoylmethane, 1,3-diphenyl-1,3-propanedione, 2-benzoylacetophenone, phenyl phenacyl ketone, 1,3-propanedione, 1,3-diphenyl, rhodiastab 83, omega-benzoylacetophenone, dibenzoyl-methane, karenzu dk2, unii-ans7me8okc | |
| C1=CC=C(C=C1)C(=O)CC(=O)C2=CC=CC=C2 | |
| 224.26 | |
| CHEBI:75417 | |
| 98% | |
| Dibenzoylmethane, 98% |
Safety and Handling
EINECSNumber : 204-398-9
RTECSNumber : TZ1930000
TSCA : TSCA
RUO – Research Use Only