missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Di-tert-butyl Malonate 98.0+%, TCI America™
Supplier: TCI America M152225G
Specifications
| Di-tert-butyl Malonate | |
| -6°C | |
| 67°C | |
| MFCD00008810 | |
| di-tert-butyl malonate, malonic acid di-tert-butyl ester, propanedioic acid, bis 1,1-dimethylethyl ester, di-t-butylmalonate, di-t-butyl malonate, unii-7e9xwt9380, 1,3-di-tert-butyl propanedioate, di tert-butyl malonate, tert-butyl 2-tert-butoxycarbonyl acetate, di-tert-butyl malonate, stab. with potassium carbonate | |
| CC(C)(C)OC(=O)CC(=O)OC(C)(C)C | |
| 216.277 | |
| 216.28 | |
| Liquid |
| 541-16-2 | |
| Colorless | |
| C11H20O4 | |
| 25 g | |
| CLPHAYNBNTVRDI-UHFFFAOYSA-N | |
| ditert-butyl propanedioate | |
| 68324 | |
| ≥98.0% (GC) |
Chemical Identifiers
| 541-16-2 | |
| 216.277 | |
| CLPHAYNBNTVRDI-UHFFFAOYSA-N | |
| 68324 | |
| CC(C)(C)OC(=O)CC(=O)OC(C)(C)C |
| C11H20O4 | |
| MFCD00008810 | |
| di-tert-butyl malonate, malonic acid di-tert-butyl ester, propanedioic acid, bis 1,1-dimethylethyl ester, di-t-butylmalonate, di-t-butyl malonate, unii-7e9xwt9380, 1,3-di-tert-butyl propanedioate, di tert-butyl malonate, tert-butyl 2-tert-butoxycarbonyl acetate, di-tert-butyl malonate, stab. with potassium carbonate | |
| ditert-butyl propanedioate |
Safety and Handling
TSCA : Yes