Learn More
Di-tert-butyl dicarbonate, 97%
CAS: 24424-99-5 | C10H18O5 | 218.25 g/mol
$292.65 - $292.65
Chemical Identifiers
| CAS | 24424-99-5 |
|---|---|
| Molecular Formula | C10H18O5 |
| Molecular Weight (g/mol) | 218.25 |
| MDL Number | MFCD00008805 |
| InChI Key | DYHSDKLCOJIUFX-UHFFFAOYSA-N |
| Synonym | di-tert-butyl dicarbonate, boc anhydride, boc-anhydride, di-t-butyl dicarbonate, di-tert-butyl pyrocarbonate, bis tert-butoxycarbonyl oxide, di-tert-butyldicarbonate, boc2o, di-t-butyl pyrocarbonate, di tert-butyl carbonate |
| PubChem CID | 90495 |
| ChEBI | CHEBI:48500 |
| IUPAC Name | tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate |
| SMILES | CC(C)(C)OC(=O)OC(=O)OC(C)(C)C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC189771000
|
Thermo Scientific Chemicals
189771000 |
100 g | Glass Bottle |
Each for $292.65
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 24424-99-5 | |
| 218.25 | |
| DYHSDKLCOJIUFX-UHFFFAOYSA-N | |
| 90495 | |
| tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate |
| C10H18O5 | |
| MFCD00008805 | |
| di-tert-butyl dicarbonate, boc anhydride, boc-anhydride, di-t-butyl dicarbonate, di-tert-butyl pyrocarbonate, bis tert-butoxycarbonyl oxide, di-tert-butyldicarbonate, boc2o, di-t-butyl pyrocarbonate, di tert-butyl carbonate | |
| CHEBI:48500 | |
| CC(C)(C)OC(=O)OC(=O)OC(C)(C)C |
Specifications
| 24424-99-5 | |
| White | |
| 56.0°C to 57.0°C (0.5 mmHg) | |
| Authentic | |
| Glass Bottle | |
| 1.4075 to 1.4095 | |
| MFCD00008805 | |
| 2930 | |
| 1.02 | |
| di-tert-butyl dicarbonate, boc anhydride, boc-anhydride, di-t-butyl dicarbonate, di-tert-butyl pyrocarbonate, bis tert-butoxycarbonyl oxide, di-tert-butyldicarbonate, boc2o, di-t-butyl pyrocarbonate, di tert-butyl carbonate | |
| CC(C)(C)OC(=O)OC(=O)OC(C)(C)C | |
| 218.25 | |
| CHEBI:48500 | |
| 97% | |
| Di-tert-butyl Dicarbonate, 97% |
| 22.0°C to 24.0°C | |
| 1.0200g/mL | |
| 37°C | |
| 97% | |
| C10H18O5 | |
| O[CO2C(CH3)3]2 | |
| 100 g | |
| 04,128; 07,91; 08,145; 10,122; 12,159; 13,94; 15,113 | |
| 15, 3038 | |
| DYHSDKLCOJIUFX-UHFFFAOYSA-N | |
| tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate | |
| 90495 | |
| 218.25 | |
| Low Melting Crystalline Solid |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye damage.
May cause respiratory irritation.
May cause an allergic skin reaction.
Fatal if inhaled.
Flammable solid.
GHS P Statement
Keep away from heat/sparks/open flames/hot surfaces.
- No smoking.
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
IF IN EYES: Rinse cauti
GHS Signal Word: Danger
EINECSNumber : 246-240-1
RTECSNumber : HT0230000
TSCA : TSCA
RUO – Research Use Only