missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Deoxybenzoin, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 111961000
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Deoxybenzoin | |
| 451-40-1 | |
| >110°C | |
| 97.5% min. (GC) | |
| C14H12O | |
| MFCD00003081 | |
| 07, II, 368 | |
| Solubility in water: soluble in hot water. Other solubilities: soluble in alcohols and ketones | |
| C1=CC=C(C=C1)CC(=O)C2=CC=CC=C2 | |
| 196.25 | |
| 196.25 |
| 98% | |
| 320.0°C | |
| Authentic | |
| Plastic bottle | |
| C6H5CH2COC6H5 | |
| 100g | |
| 2-phenylacetophenone, deoxybenzoin, benzyl phenyl ketone, ethanone, 1,2-diphenyl, desoxybenzoin, 1,2-diphenylethan-1-one, phenyl benzyl ketone, benzoin, deoxy, acetophenone, 2-phenyl, deoxy benzoin | |
| OTKCEEWUXHVZQI-UHFFFAOYSA-N | |
| 1,2-diphenylethanone | |
| 9948 | |
| 98% |
Chemical Identifiers
| 451-40-1 | |
| 196.25 | |
| OTKCEEWUXHVZQI-UHFFFAOYSA-N | |
| 9948 | |
| C1=CC=C(C=C1)CC(=O)C2=CC=CC=C2 |
| C14H12O | |
| MFCD00003081 | |
| 2-phenylacetophenone, deoxybenzoin, benzyl phenyl ketone, ethanone, 1,2-diphenyl, desoxybenzoin, 1,2-diphenylethan-1-one, phenyl benzyl ketone, benzoin, deoxy, acetophenone, 2-phenyl, deoxy benzoin | |
| 1,2-diphenylethanone |
Safety and Handling
EINECSNumber : 207-193-2
RTECSNumber : AM9662500
TSCA : TSCA
RUO â Research Use Only