missing translation for 'onlineSavingsMsg'
Learn More
Learn More
d-Vitamin E Succinate, USP, 96-102%, Spectrum™ Chemical
V1035, 4345-03-3, C33H54O5
Supplier: Spectrum Chemical Mfg Cor V1035500GM
Description
Spectrum™ Chemical d-Vitamin E Succinate, USP is a fat-soluble antioxidant. All Spectrum Chemical USP grade products are manufactured, packaged and stored under current Good Manufacturing Practices (cGMP) per 21CFR part 211 in FDA registered and inspected facilities.Specifications
| RRR-Vitamin E Succinate | |
| 100% | |
| Amber Glass Bottle | |
| 500 g | |
| CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCC2=C(C)C(OC(=O)CCC(O)=O)=C(C)C(C)=C2O1 | |
| 530.79 | |
| USP |
| 4345-03-3 | |
| 75°C | |
| C33H54O5 | |
| IELOKBJPULMYRW-NJQVLOCASA-N | |
| 4-oxo-4-{[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-1-benzopyran-6-yl]oxy}butanoic acid | |
| 96 to 102% | |
| Crystalline Powder or Lumps |
Chemical Identifiers
| 4345-03-3 | |
| 530.79 | |
| 4-oxo-4-{[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-1-benzopyran-6-yl]oxy}butanoic acid |
| C33H54O5 | |
| IELOKBJPULMYRW-NJQVLOCASA-N | |
| CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCC2=C(C)C(OC(=O)CCC(O)=O)=C(C)C(C)=C2O1 |