missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals D(+)-Trehalose dihydrate, 99%
CAS: 6138-23-4 | C12H26O13 | 378.33 g/mol
$176.17 - $6132.22
Chemical Identifiers
| CAS | 6138-23-4 |
|---|---|
| Molecular Formula | C12H26O13 |
| Molecular Weight (g/mol) | 378.33 |
| MDL Number | MFCD00071594 |
| InChI Key | DPVHGFAJLZWDOC-DJCWUSJTNA-N |
| Synonym | trehalose dihydrate, d-+-trehalose dihydrate, a,a-trehalose, d +-trehalose dihydrate, unii-7yin7j07x4, alpha,alpha-trehalose dihydrate, d-trehalose dihydrate, mycose,1-o-alpha-d-glucopyranosyl-alpha-d-glucopyranoside, alp,alp.-trehalose, 2r,3s,4s,5r,6r-2-hydroxymethyl-6-2r,3r,4s,5s,6r-3,4,5-trihydroxy-6-hydroxymethyl tetrahydropyran-2-yl oxy-tetrahydropyran-3,4,5-triol |
| PubChem CID | 181978 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-3,4,5-triol;dihydrate |
| SMILES | O.O.OC[C@H]1O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC182550250
|
Thermo Scientific Chemicals
182550250 |
25 g | Glass bottle |
Each for $176.17
|
|
||||
|
AC182551000
|
Thermo Scientific Chemicals
182551000 |
100 g | Glass bottle |
Each for $479.20
|
|
||||
|
AC182555000
|
Thermo Scientific Chemicals
182555000 |
500 g | Glass bottle |
Each for $1,829.66
|
|
||||
|
AC182550025
|
Thermo Scientific Chemicals
182550025 |
2.5 kg | Plastic Bottle |
Each for $6,132.22
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 6138-23-4 | |
| 378.33 | |
| DPVHGFAJLZWDOC-DJCWUSJTNA-N | |
| 181978 | |
| O.O.OC[C@H]1O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| C12H26O13 | |
| MFCD00071594 | |
| trehalose dihydrate, d-+-trehalose dihydrate, a,a-trehalose, d +-trehalose dihydrate, unii-7yin7j07x4, alpha,alpha-trehalose dihydrate, d-trehalose dihydrate, mycose,1-o-alpha-d-glucopyranosyl-alpha-d-glucopyranoside, alp,alp.-trehalose, 2r,3s,4s,5r,6r-2-hydroxymethyl-6-2r,3r,4s,5s,6r-3,4,5-trihydroxy-6-hydroxymethyl tetrahydropyran-2-yl oxy-tetrahydropyran-3,4,5-triol | |
| (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-3,4,5-triol;dihydrate |
Specifications
| 6138-23-4 | |
| 98.5% min. (ELSD) (HPLC) | |
| C12H26O13 | |
| 25 g | |
| + 179.00 (20.00°C c=2,H2O) | |
| trehalose dihydrate, d-+-trehalose dihydrate, a,a-trehalose, d +-trehalose dihydrate, unii-7yin7j07x4, alpha,alpha-trehalose dihydrate, d-trehalose dihydrate, mycose,1-o-alpha-d-glucopyranosyl-alpha-d-glucopyranoside, alp,alp.-trehalose, 2r,3s,4s,5r,6r-2-hydroxymethyl-6-2r,3r,4s,5s,6r-3,4,5-trihydroxy-6-hydroxymethyl tetrahydropyran-2-yl oxy-tetrahydropyran-3,4,5-triol | |
| DPVHGFAJLZWDOC-DJCWUSJTNA-N | |
| (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-3,4,5-triol;dihydrate | |
| 181978 | |
| 99% |
| 97.0°C to 99.0°C | |
| Glass bottle | |
| MFCD00071594 | |
| 159742 | |
| + 179.00 | |
| (10% in water) Clear colorless | |
| O.O.OC[C@H]1O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O | |
| 378.33 | |
| 378.32 | |
| D(+)-Trehalose dihydrate |
Safety and Handling
May form combustible dust concentrations in air
Warning
RUO – Research Use Only