Learn More
D(+)-Sucrose, ACS reagent, Thermo Scientific™
D(+)-Sucrose, CAS # 57-50-1, is a disaccharide used in a variety of biochemical applications such as protein purification. It is also known as sugar, sucrose, alpha-D-glucopyranoside, and D-(+)-saccharose.
Supplier: Thermo Scientific Chemicals 424500250
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| D(+)-Sucrose | |
| 0.01% max. | |
| Authentic | |
| 25kg | |
| +66.3° to +66.8° (25°C, 589nm) (c=26, H2O) | |
| 0.005% max. Insoluble Matter | |
| C(C1C(C(C(C(O1)OC2(C(C(C(O2)CO)O)O)CO)O)O)O)O | |
| 342.297 | |
| CHEBI:17992 | |
| ACS Reagent |
| 57-50-1 | |
| 0.03% max. (105°C) | |
| C12H22O11 | |
| MFCD00006626 | |
| sucrose, saccharose, cane sugar, sugar, table sugar, white sugar, d-sucrose, saccharum, rohrzucker, amerfand | |
| CZMRCDWAGMRECN-UGDNZRGBSA-N | |
| (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol | |
| 5988 | |
| 342.29 |