missing translation for 'onlineSavingsMsg'
Learn More
Learn More
D(+)-Phenyllactic acid, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 344580050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| D(+)-Phenyllactic acid | |
| 7326-19-4 | |
| 98% | |
| C9H10O3 | |
| MFCD00078062 | |
| +18.5° (20°C c=1,CH3OH) | |
| r-2-hydroxy-3-phenylpropionic acid, a-hydroxy-3-phenylpropionic acid, 2r-2-hydroxy-3-phenylpropanoic acid, d-+-phenyllactic acid, d-+-phenyllactic acid, r-phenyllactate, r-phenyllactate, r-+-3-phenyllactic acid, 3-phenyl-d-lactic acid, r-, r- | |
| O[C@H](CC1=CC=CC=C1)C(O)=O | |
| 166.18 | |
| CHEBI:32978 | |
| 98% |
| 98% | |
| Authentic | |
| Glass bottle | |
| C6H5CH2CH(OH)COOH | |
| 5g | |
| + 18.5 | |
| VOXXWSYKYCBWHO-MRVPVSSYSA-N | |
| (2R)-2-hydroxy-3-phenylpropanoic acid | |
| 643327 | |
| 166.18 |
Chemical Identifiers
| 7326-19-4 | |
| 166.18 | |
| VOXXWSYKYCBWHO-MRVPVSSYSA-N | |
| 643327 | |
| (2R)-2-hydroxy-3-phenylpropanoic acid |
| C9H10O3 | |
| MFCD00078062 | |
| r-2-hydroxy-3-phenylpropionic acid, a-hydroxy-3-phenylpropionic acid, 2r-2-hydroxy-3-phenylpropanoic acid, d-+-phenyllactic acid, d-+-phenyllactic acid, r-phenyllactate, r-phenyllactate, r-+-3-phenyllactic acid, 3-phenyl-d-lactic acid, r-, r- | |
| CHEBI:32978 | |
| O[C@H](CC1=CC=CC=C1)C(O)=O |
Safety and Handling
EINECSNumber : 230-803-3
RUO â Research Use Only