missing translation for 'onlineSavingsMsg'
Learn More
Learn More
D(+)-Phenyllactic acid, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 344580050
| Quantity | 5g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| C9H10O3 | |
| MFCD00078062 | |
| r-2-hydroxy-3-phenylpropionic acid, r-2-hydroxy-3-phenylpropanoic acid, 2r-2-hydroxy-3-phenylpropanoic acid, d-+-phenyllactic acid, d-+-3-phenyllactic acid, r-phenyllactate, r-+-3-phenyllactic acid, 3-phenyl-d-lactic acid, r-3-phenyllactic acid, r-, a-hydroxy-3-phenylpropionic acid | |
| CHEBI:32978 | |
| O[C@H](CC1=CC=CC=C1)C(O)=O |
Specifications
| D(+)-Phenyllactic acid | |
| 7326-19-4 | |
| 98% | |
| C9H10O3 | |
| 5g | |
| +18.5° (20°C c=1,CH3OH) | |
| r-2-hydroxy-3-phenylpropionic acid, r-2-hydroxy-3-phenylpropanoic acid, 2r-2-hydroxy-3-phenylpropanoic acid, d-+-phenyllactic acid, d-+-3-phenyllactic acid, r-phenyllactate, r-+-3-phenyllactic acid, 3-phenyl-d-lactic acid, r-3-phenyllactic acid, r-, a-hydroxy-3-phenylpropionic acid | |
| O[C@H](CC1=CC=CC=C1)C(O)=O | |
| 166.18 | |
| CHEBI:32978 | |
| 98% |
| 98% | |
| Authentic | |
| Glass bottle | |
| C6H5CH2CH(OH)COOH | |
| MFCD00078062 | |
| + 18.5 | |
| VOXXWSYKYCBWHO-MRVPVSSYSA-N | |
| (2R)-2-hydroxy-3-phenylpropanoic acid | |
| 643327 | |
| 166.18 |
Safety and Handling
EINECSNumber : 230-803-3