missing translation for 'onlineSavingsMsg'
Learn More
Learn More
D-Phenylalanine methyl ester hydrochloride, 98%
CAS: 13033-84-6 | C10H14ClNO2 | 215.68 g/mol
$89.33 - $89.33
Chemical Identifiers
| CAS | 13033-84-6 |
|---|---|
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight (g/mol) | 215.68 |
| MDL Number | MFCD00066112 |
| InChI Key | SWVMLNPDTIFDDY-SBSPUUFOSA-N |
| Synonym | d-phenylalanine methyl ester hydrochloride, h-d-phe-ome.hcl, d-phenylalanine methyl ester hcl, h-d-phe-ome hcl, r-methyl 2-amino-3-phenylpropanoate hydrochloride, d-phenylalanine, methyl ester, hydrochloride, methyl d-phenylalaninate hydrochloride, r-phenylalanine methyl ester hydrochloride, methyl 2r-2-amino-3-phenylpropanoate hydrochloride |
| PubChem CID | 11481330 |
| IUPAC Name | methyl (2R)-2-amino-3-phenylpropanoate;hydrochloride |
| SMILES | Cl.COC(=O)[C@H](N)CC1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC442620050
|
Thermo Scientific Chemicals
442620050 |
5 g |
N/A
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 13033-84-6 | |
| 215.68 | |
| SWVMLNPDTIFDDY-SBSPUUFOSA-N | |
| 11481330 | |
| Cl.COC(=O)[C@H](N)CC1=CC=CC=C1 |
| C10H14ClNO2 | |
| MFCD00066112 | |
| d-phenylalanine methyl ester hydrochloride, h-d-phe-ome.hcl, d-phenylalanine methyl ester hcl, h-d-phe-ome hcl, r-methyl 2-amino-3-phenylpropanoate hydrochloride, d-phenylalanine, methyl ester, hydrochloride, methyl d-phenylalaninate hydrochloride, r-phenylalanine methyl ester hydrochloride, methyl 2r-2-amino-3-phenylpropanoate hydrochloride | |
| methyl (2R)-2-amino-3-phenylpropanoate;hydrochloride |
Specifications
| 13033-84-6 | |
| White | |
| 97.5% min. (HPLC) | |
| MFCD00066112 | |
| -35.76 | |
| SWVMLNPDTIFDDY-SBSPUUFOSA-N | |
| methyl (2R)-2-amino-3-phenylpropanoate;hydrochloride | |
| 11481330 | |
| 98% | |
| D-Phenylalanine methyl ester hydrochloride |
| 157°C to 159°C | |
| Authentic | |
| C10H14ClNO2 | |
| 5 g | |
| d-phenylalanine methyl ester hydrochloride, h-d-phe-ome.hcl, d-phenylalanine methyl ester hcl, h-d-phe-ome hcl, r-methyl 2-amino-3-phenylpropanoate hydrochloride, d-phenylalanine, methyl ester, hydrochloride, methyl d-phenylalaninate hydrochloride, r-phenylalanine methyl ester hydrochloride, methyl 2r-2-amino-3-phenylpropanoate hydrochloride | |
| Cl.COC(=O)[C@H](N)CC1=CC=CC=C1 | |
| 215.68 | |
| 215.68 | |
| Crystalline Powder or Powder |
RUO – Research Use Only