missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals D-Panthenol, 98+%
CAS: 81-13-0 | C9H19NO4 | 205.25 g/mol
Supplier: Thermo Scientific Chemicals 232801000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| D-Panthenol | |
| 81-13-0 | |
| 118°C to 120°C (2.7 Pa) | |
| 98% min | |
| C9H19NO4 | |
| HOCH2C(CH3)2CH(OH)CONH(CH2)3OH | |
| 100 g | |
| 15, 2949 | |
| + 30.50 | |
| Solubility in water: freely soluble. Other solubilities: freely soluble in methanol,ethanol,sparingly soluble in chloroform,slightly soluble in diethyl ether,insoluble in fats and oils | |
| CC(C)(CO)[C@@H](O)C(=O)NCCCO | |
| 205.25 | |
| CHEBI:27373 | |
| 98+% |
| 98+% | |
| Colorless to Yellow | |
| Authentic | |
| Glass bottle | |
| 1.4950 to 1.5020 | |
| MFCD00065006 | |
| 04,III,75 | |
| +30.50° (20°C c=5,H2O on anh. sub) | |
| dexpanthenol, d-panthenol, pantothenol, bepanthen, d-pantothenyl alcohol, ilopan, +-panthenol, bepanthene, panthoderm, thenalton | |
| SNPLKNRPJHDVJA-ZETCQYMHSA-N | |
| (2R)-2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutanamide | |
| 131204 | |
| 205.26 | |
| Viscous Liquid or Semi Solid |
Chemical Identifiers
| 81-13-0 | |
| 205.25 | |
| SNPLKNRPJHDVJA-ZETCQYMHSA-N | |
| 131204 | |
| (2R)-2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutanamide |
| C9H19NO4 | |
| MFCD00065006 | |
| dexpanthenol, d-panthenol, pantothenol, bepanthen, d-pantothenyl alcohol, ilopan, +-panthenol, bepanthene, panthoderm, thenalton | |
| CHEBI:27373 | |
| CC(C)(CO)[C@@H](O)C(=O)NCCCO |
Safety and Handling
HYGROSCOPIC
EINECSNumber : 201-327-3
RTECSNumber : ES4316000
TSCA : TSCA
RUO – Research Use Only