missing translation for 'onlineSavingsMsg'
Learn More
Learn More
D-Gluconic acid, calcium salt, 99%
CAS: 299-28-5 | C12H22CaO14 | 430.372 g/mol
$78.01 - $78.01
Chemical Identifiers
| CAS | 299-28-5 |
|---|---|
| Molecular Formula | C12H22CaO14 |
| Molecular Weight (g/mol) | 430.372 |
| MDL Number | MFCD00064209 |
| InChI Key | NEEHYRZPVYRGPP-IYEMJOQQSA-L |
| Synonym | calcium gluconate, calcium d-gluconate, calciofon, calglucon, glucobiogen, ebucin, calcicol, calcipur, calglucol, dragocal |
| PubChem CID | 9290 |
| IUPAC Name | calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC211062500
|
Thermo Scientific Chemicals
211062500 |
250 g | Plastic bottle |
N/A
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 299-28-5 | |
| 430.372 | |
| NEEHYRZPVYRGPP-IYEMJOQQSA-L | |
| 9290 | |
| C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2] |
| C12H22CaO14 | |
| MFCD00064209 | |
| calcium gluconate, calcium d-gluconate, calciofon, calglucon, glucobiogen, ebucin, calcicol, calcipur, calglucol, dragocal | |
| calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
Specifications
| 299-28-5 | |
| 2.0 % max. (1 g, 105°C, 16 hrs) | |
| 0.99 | |
| C12H22CaO14 | |
| MFCD00064209 | |
| 03, 544 | |
| + 10.20 (22.00°C c=1,H2O) | |
| calcium gluconate, calcium d-gluconate, calciofon, calglucon, glucobiogen, ebucin, calcicol, calcipur, calglucol, dragocal | |
| C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2] | |
| 430.372 | |
| 430.38 | |
| Crystalline Powder or Crystals |
| White | |
| Authentic | |
| Plastic bottle | |
| (HOCH2[CH(OH)]4CO2)2Ca | |
| 250 g | |
| 15, 1671 | |
| + 10.20 | |
| NEEHYRZPVYRGPP-IYEMJOQQSA-L | |
| calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate | |
| 9290 | |
| 0.99 | |
| D-Gluconic acid, calcium salt |
RUO – Research Use Only