missing translation for 'onlineSavingsMsg'
Learn More
Learn More
D-Gluconic acid, calcium salt, 99%
CAS: 299-28-5 | C12H22CaO14 | 430.372 g/mol
Supplier: Thermo Scientific Chemicals 211062500
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| D-Gluconic acid, calcium salt | |
| White | |
| Authentic | |
| Plastic bottle | |
| (HOCH2[CH(OH)]4CO2)2Ca | |
| 250 g | |
| 15, 1671 | |
| + 10.20 | |
| NEEHYRZPVYRGPP-IYEMJOQQSA-L | |
| calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate | |
| 9290 | |
| 0.99 |
| 299-28-5 | |
| 2.0 % max. (1 g, 105°C, 16 hrs) | |
| 0.99 | |
| C12H22CaO14 | |
| MFCD00064209 | |
| 03, 544 | |
| + 10.20 (22.00°C c=1,H2O) | |
| calcium gluconate, calcium d-gluconate, calciofon, calglucon, glucobiogen, ebucin, calcicol, calcipur, calglucol, dragocal | |
| C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2] | |
| 430.372 | |
| 430.38 | |
| Crystalline Powder or Crystals |
Chemical Identifiers
| 299-28-5 | |
| 430.372 | |
| NEEHYRZPVYRGPP-IYEMJOQQSA-L | |
| 9290 | |
| C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2] |
| C12H22CaO14 | |
| MFCD00064209 | |
| calcium gluconate, calcium d-gluconate, calciofon, calglucon, glucobiogen, ebucin, calcicol, calcipur, calglucol, dragocal | |
| calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
RUO – Research Use Only