missing translation for 'onlineSavingsMsg'
Learn More
Learn More
D(+)-Cellobiose; ≥99%, MP Biomedicals™
Cellobiose is a disaccharide composed of two glucose molecules; These are β-1,4-glycosidically linked. It is reducing sugar, which is readily soluble in polar solvents such as water and ethanol
Supplier: MP Biomedicals Inc 0210129810
| Quantity | 10 g |
|---|
Chemical Identifiers
| C12H22O11 | |
| MFCD00136034 | |
| d-+-cellobiose, 4-o-beta-glucopyranosyl-d-glucose | |
| OCC1OC(OC2C(O)C(O)C(O)OC2CO)C(O)C(O)C1O |
Specifications
| D(+)-Cellobiose | |
| White | |
| C12H22O11 | |
| MFCD00136034 | |
| GUBGYTABKSRVRQ-UHFFFAOYNA-N | |
| (3S,4S,6S)-2-(hydroxymethyl)-6-[(3S,4R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol | |
| 57370084 | |
| Crystalline Powder |
| 528-50-7 | |
| ≥99% | |
| 10 g | |
| d-+-cellobiose, 4-o-beta-glucopyranosyl-d-glucose | |
| OCC1OC(OC2C(O)C(O)C(O)OC2CO)C(O)C(O)C1O | |
| 342.30 | |
| 342.3 |
Safety and Handling
EINECSNumber : 208-436-5
Recommended Storage : Store at Room Temperature