missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals D-Calcium pantothenate, 98%
CAS: 137-08-6 | C18H32CaN2O10 | 476.54 g/mol
$71.36 - $406.12
Chemical Identifiers
| CAS | 137-08-6 |
|---|---|
| Molecular Formula | C18H32CaN2O10 |
| Molecular Weight (g/mol) | 476.54 |
| MDL Number | MFCD00002766 |
| InChI Key | FAPWYRCQGJNNSJ-DXHDTSSINA-L |
| Synonym | calcium pantothenate, d-pantothenic acid hemicalcium salt, d-pantothenic acid, calcium salt, pantothenic acid, calcium salt, d, r-n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-beta-alanine calcium salt, beta-alanine, n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-, calcium salt, r |
| PubChem CID | 131847364 |
| IUPAC Name | calcium;3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoic acid |
| SMILES | [Ca++].CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O.CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC243300050
|
Thermo Scientific Chemicals
243300050 |
5 g | Glass Bottle |
Each for $71.36
|
|
||||
|
AC243301000
|
Thermo Scientific Chemicals
243301000 |
100 g | Plastic Bottle |
Each for $140.71
|
|
||||
|
AC243305000
|
Thermo Scientific Chemicals
243305000 |
500 g | Plastic Bottle |
Each for $406.12
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 137-08-6 | |
| 476.54 | |
| FAPWYRCQGJNNSJ-DXHDTSSINA-L | |
| 131847364 | |
| [Ca++].CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O.CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O |
| C18H32CaN2O10 | |
| MFCD00002766 | |
| calcium pantothenate, d-pantothenic acid hemicalcium salt, d-pantothenic acid, calcium salt, pantothenic acid, calcium salt, d, r-n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-beta-alanine calcium salt, beta-alanine, n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-, calcium salt, r | |
| calcium;3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoic acid |
Specifications
| 190°C | |
| White | |
| 5.0% max. (105°C, 3 hrs) | |
| C18H32CaN2O10 | |
| [HOCH2C(CH3)2CHOHCONHCH2CH2COO]2Ca | |
| + 25 | |
| calcium pantothenate, d-pantothenic acid hemicalcium salt, d-pantothenic acid, calcium salt, pantothenic acid, calcium salt, d, r-n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-beta-alanine calcium salt, beta-alanine, n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-, calcium salt, r | |
| FAPWYRCQGJNNSJ-DXHDTSSINA-L | |
| calcium;3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoic acid | |
| 5 g | |
| 476.52 | |
| Powder |
| 137-08-6 | |
| Authentic | |
| 8.2 to 8.6% (Ca) On dried substance (Complexometry) | |
| Glass Bottle | |
| MFCD00002766 | |
| 15, 7118 | |
| Solubility in water: 350g/L (20°C). Other solubilities: soluble in glycerine,very slightly soluble in ethanol,insoluble in ether,chloroform | |
| [Ca++].CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O.CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O | |
| 476.54 | |
| 131847364 | |
| 98% | |
| D-Calcium pantothenate |
Safety and Handling
EINECSNumber : 205-278-9
RUO – Research Use Only