missing translation for 'onlineSavingsMsg'
Learn More
Learn More
D and C Yellow No. 10, Spectrum™ Chemical
DC200, 8004-92-0, C18H9NO8S2Na
Supplier: Spectrum Chemical Mfg Cor DC2005KGBL
Description
Spectrum™ Chemical D and C Yellow No. 10Specifications
| D and C Yellow No. 10 | |
| 100% | |
| MFCD00080727 | |
| [Na+].[Na+].[O-]S(=O)(=O)C1=CC(=C2N=C(C=CC2=C1)C1C(=O)C2=CC=CC=C2C1=O)S([O-])(=O)=O | |
| 477.37 | |
| Reagent | |
| Yellow |
| 8004-92-0 | |
| C18H9NNa2O8S2 | |
| FZUOVNMHEAPVBW-UHFFFAOYSA-L | |
| disodium 2-(1,3-dioxo-2,3-dihydro-1H-inden-2-yl)quinoline-6,8-disulfonate | |
| 85% | |
| Amber Glass Bottle | |
| 5 kg |
Chemical Identifiers
| 8004-92-0 | |
| 477.37 | |
| FZUOVNMHEAPVBW-UHFFFAOYSA-L | |
| [Na+].[Na+].[O-]S(=O)(=O)C1=CC(=C2N=C(C=CC2=C1)C1C(=O)C2=CC=CC=C2C1=O)S([O-])(=O)=O |
| C18H9NNa2O8S2 | |
| MFCD00080727 | |
| disodium 2-(1,3-dioxo-2,3-dihydro-1H-inden-2-yl)quinoline-6,8-disulfonate |