Learn More
D-Biotin, Fisher BioReagents
Supplier: Fisher BioReagents BIOTIN
Description
D-Biotin, which forms a stable complex with Avidin, is useful in the study of Avidin-Biotin interactions and in affinity chromatography.Specifications
| Biotin | |
| 58-85-5 | |
| White | |
| ≥99 % | |
| C10H16N2O3S | |
| 1 g | |
| +89 to +93° (+ or -) | |
| YBJHBAHKTGYVGT-UHFFFAOYNA-N | |
| 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid | |
| 171548 | |
| 244.31 | |
| ≥99% |
| D-Biotin | |
| 228.9°C | |
| 4.5 | |
| Amber Glass | |
| MFCD00005541 | |
| 15, 1236 | |
| biotin, d-biotin, vitamin h, coenzyme r, vitamin b7, bios ii, factor s, bioepiderm, d +-biotin, biodermatin | |
| OC(=O)CCCCC1SCC2NC(=O)NC12 | |
| 244.31 | |
| CHEBI:15956 | |
| Negligible | |
| Solid |
Chemical Identifiers
| 58-85-5 | |
| 244.31 | |
| YBJHBAHKTGYVGT-UHFFFAOYNA-N | |
| 171548 | |
| 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid |
| C10H16N2O3S | |
| MFCD00005541 | |
| biotin, d-biotin, vitamin h, coenzyme r, vitamin b7, bios ii, factor s, bioepiderm, d +-biotin, biodermatin | |
| CHEBI:15956 | |
| OC(=O)CCCCC1SCC2NC(=O)NC12 |
Safety and Handling
CAUTION!
Emergency Overview
May cause eye, skin, and respiratory tract irritation. Use personal protective equipment. Ensure adequate ventilation. Wash off immediately with plenty of water for at least 15 minutes. Get medical attention immediately if symptoms occur. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. If breathing is difficult, give oxygen. Get medical attention immediately if symptoms occur. Do not induce vomiting. Obtain medical attention. Obtain medical attention. .
NFPA
Health:1
Flammability:0
Instability:0
Recommended Storage : -2° to 8°C in refrigerator