Learn More
D-(+)-Biotin, 98+%
CAS: 58-85-5 | C10H16N2O3S | 244.31 g/mol
$143.52 - $2437.89
Chemical Identifiers
| CAS | 58-85-5 |
|---|---|
| Molecular Formula | C10H16N2O3S |
| Molecular Weight (g/mol) | 244.31 |
| MDL Number | MFCD00005541 |
| InChI Key | YBJHBAHKTGYVGT-UHFFFAOYNA-N |
| Synonym | biotin, d-biotin, vitamin h, coenzyme r, vitamin b7, bios ii, factor s, bioepiderm, d +-biotin, biodermatin |
| PubChem CID | 171548 |
| ChEBI | CHEBI:15956 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid |
| SMILES | OC(=O)CCCCC1SCC2NC(=O)NC12 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAA1420703
|
Thermo Scientific Chemicals
A1420703 |
1 g |
Each for $143.52
|
|
|||||
|
AAA1420706
|
Thermo Scientific Chemicals
A1420706 |
5 g |
Each for $552.53
|
|
|||||
|
AAA1420709
|
Thermo Scientific Chemicals
A1420709 |
10 g |
Each for $1,122.74
|
|
|||||
|
AAA1420714
|
Thermo Scientific Chemicals
A1420714 |
25 g |
Each for $2,437.89
|
|
|||||
Description
Biotin is a form of vitamin B that helps the body to break down fats and carbohydrates. It is used as an alternative medicine to treat or prevent biotin deficiency, which is caused by malnutrition, rapid weight loss, long-term tube feeding and other medical conditions. It is an essential vitamin which is important for amino acid and energy metabolism.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
SolubilitySoluble in hot water, dimethyl sulfoxide, alcohol and benzene.
Notes
Store in cool place. Incompatible with strong oxidizing agents.
Chemical Identifiers
| 58-85-5 | |
| 244.31 | |
| YBJHBAHKTGYVGT-UHFFFAOYNA-N | |
| 171548 | |
| 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid |
| C10H16N2O3S | |
| MFCD00005541 | |
| biotin, d-biotin, vitamin h, coenzyme r, vitamin b7, bios ii, factor s, bioepiderm, d +-biotin, biodermatin | |
| CHEBI:15956 | |
| OC(=O)CCCCC1SCC2NC(=O)NC12 |
Specifications
| 58-85-5 | |
| ≥98% | |
| MFCD00005541 | |
| 86838 | |
| 14,1231 | |
| Soluble in hot water,dimethyl sulfoxide,alcohol and benzene. | |
| OC(=O)CCCCC1SCC2NC(=O)NC12 | |
| 244.31 | |
| CHEBI:15956 | |
| ≥98% |
| 224°C to 226°C | |
| C10H16N2O3S | |
| 1 g | |
| Light sensitive | |
| biotin, d-biotin, vitamin h, coenzyme r, vitamin b7, bios ii, factor s, bioepiderm, d +-biotin, biodermatin | |
| YBJHBAHKTGYVGT-UHFFFAOYNA-N | |
| 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid | |
| 171548 | |
| 244.32 | |
| D-(+)-Biotin |
Safety and Handling
EINECSNumber : 200-399-3
RTECSNumber : XJ9088200
TSCA : Yes
Recommended Storage : Keep cold
RUO – Research Use Only