Learn More
D(+)-10-Camphorsulfonic acid, 99%
CAS: 3144-16-9 | C10H15O4S | 231.29 g/mol
Supplier: Thermo Scientific Chemicals 108225000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| D(+)-10-Camphorsulfonic acid | |
| 3144-16-9 | |
| White | |
| Authentic | |
| Plastic bottle | |
| MFCD00064157,MFCD00074827 | |
| 11,IV,642 | |
| 15, 1736 | |
| 1s,4r-7,7-dimethyl-2-oxobicyclo 2.2.1 heptan-1-yl methanesulfonic acid, d-camphorsulfonic acid, r-camphorsulfonic acid, unii-9tlz01s15l, d-+-10-camphorsulfonic acid, d-+-camphor-10-sulfonic acid, dl-10-camphorsulfonic acid, camphor-10-sulfonic acid, camphersulfosaeure german, d-camphor-10-sulfonic acid | |
| MIOPJNTWMNEORI-XVKPBYJWSA-M | |
| [(1R,4S)-7,7-dimethyl-3-oxo-4-bicyclo[2.2.1]heptanyl]methanesulfonic acid | |
| 65617 | |
| 232.3 | |
| Crystalline Powder |
| 99% | |
| >190.0°C | |
| 2% max. (1 g, 105°C, 5 hrs) | |
| 99% | |
| C10H15O4S | |
| 500 g | |
| 01,108; 02,58; 04,68; 13,62; 14,71; 16,58 | |
| + 22.00 | |
| Solubility in water: soluble. Other solubilities: slightly soluble in glacial acetic acid,slightly soluble in ethyl acetate,practically insoluble in ether,very soluble in ethanol | |
| CC1(C)[C@H]2CC[C@]1(CS([O-])(=O)=O)C(=O)C2 | |
| 231.29 | |
| CHEBI:55403 | |
| 99% |
Chemical Identifiers
| 3144-16-9 | |
| 231.29 | |
| MIOPJNTWMNEORI-XVKPBYJWSA-M | |
| 65617 | |
| [(1R,4S)-7,7-dimethyl-3-oxo-4-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
| C10H15O4S | |
| MFCD00064157,MFCD00074827 | |
| 1s,4r-7,7-dimethyl-2-oxobicyclo 2.2.1 heptan-1-yl methanesulfonic acid, d-camphorsulfonic acid, r-camphorsulfonic acid, unii-9tlz01s15l, d-+-10-camphorsulfonic acid, d-+-camphor-10-sulfonic acid, dl-10-camphorsulfonic acid, camphor-10-sulfonic acid, camphersulfosaeure german, d-camphor-10-sulfonic acid | |
| CHEBI:55403 | |
| CC1(C)[C@H]2CC[C@]1(CS([O-])(=O)=O)C(=O)C2 |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if pre
GHS Signal Word: Danger
EINECSNumber : 221-554-1
RTECSNumber : ED1550000
TSCA : TSCA
RUO – Research Use Only