Learn More
Cyclopropylboronic acid pinacol ester, 95%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 428590050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Cyclopropylboronic acid pinacol ester | |
| 0.9220g/mL | |
| 40°C | |
| Glass bottle | |
| MFCD05663847 | |
| 0.922 | |
| XGBMQBPLWXTEPM-UHFFFAOYSA-N | |
| 2-cyclopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | |
| 2758015 | |
| 95% |
| 126689-01-8 | |
| 146.0°C | |
| 94% min. (GC) | |
| C9H17BO2 | |
| 5g | |
| cyclopropylboronic acid pinacol ester, cyclopropylboronic acid, pinacol ester, 4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl cyclopropane, 1,3,2-dioxaborolane, 2-cyclopropyl-4,4,5,5-tetramethyl, 2-cyclopropyl-4,4,5,5-tetramethyl-1,3,2 dioxaborolane, 2-cyclopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborol, cypbe, pubchem4015, pubchem7931, acmc-209bbh | |
| B1(OC(C(O1)(C)C)(C)C)C2CC2 | |
| 168.04 | |
| 168.04 |
Chemical Identifiers
| 126689-01-8 | |
| 168.04 | |
| XGBMQBPLWXTEPM-UHFFFAOYSA-N | |
| 2758015 | |
| B1(OC(C(O1)(C)C)(C)C)C2CC2 |
| C9H17BO2 | |
| MFCD05663847 | |
| cyclopropylboronic acid pinacol ester, cyclopropylboronic acid, pinacol ester, 4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl cyclopropane, 1,3,2-dioxaborolane, 2-cyclopropyl-4,4,5,5-tetramethyl, 2-cyclopropyl-4,4,5,5-tetramethyl-1,3,2 dioxaborolane, 2-cyclopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborol, cypbe, pubchem4015, pubchem7931, acmc-209bbh | |
| 2-cyclopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
Safety and Handling
GHS H Statement
Flammable liquid and vapour.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
Keep away from heat/sparks/open flames/hot surfaces.
- No smoking.
IF ON SKIN (or hair): Take off immediately all contaminated clothing.
Rin
GHS Signal Word: Warning
RUO â Research Use Only