missing translation for 'onlineSavingsMsg'
Learn More
Learn More
MilliporeSigma™ Cycloheximide, InSolution™, Calbiochem™,
Supplier: MilliporeSigma™ 2397651ML
Description
Recommended Storage
2°C to 8°C
Greener Choice Claims
- Environmental benefits include:
- Recyclable
Specifications
| 66-81-9 | |
| C15H23NO4 | |
| 1 mL | |
| YPHMISFOHDHNIV-QTEFRXOUNA-N | |
| 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione | |
| 6197 | |
| Liquid |
| Alu drum | |
| MFCD00082346 | |
| cycloheximide, actidione, cycloheximide, naramycin a, kaken, actidion, actidone, hizarocin, naramycin, neocycloheximide | |
| [H][C@]1(C[C@@H](C)C[C@H](C)C1=O)[C@H](O)CC1CC(=O)NC(=O)C1 | |
| 281.35 | |
| CHEBI:27641 |
Chemical Identifiers
| 66-81-9 | |
| 281.35 | |
| YPHMISFOHDHNIV-QTEFRXOUNA-N | |
| 6197 | |
| 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione |
| C15H23NO4 | |
| MFCD00082346 | |
| cycloheximide, actidione, cycloheximide, naramycin a, kaken, actidion, actidone, hizarocin, naramycin, neocycloheximide | |
| CHEBI:27641 | |
| [H][C@]1(C[C@@H](C)C[C@H](C)C1=O)[C@H](O)CC1CC(=O)NC(=O)C1 |
Safety and Handling
Recommended Storage : 2°C to 8°C