missing translation for 'onlineSavingsMsg'
Learn More
Learn More
gamma-Cyclodextrin hydrate, 99%
CAS: 91464-90-3 | C48H80O40 | 1297.13 g/mol
Supplier: Thermo Scientific Chemicals 229900050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chelation/Complexation reagentSpecifications
| γ-Cyclodextrin hydrate | |
| 267.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00149574 | |
| 14, 2718 | |
| + 177.00 | |
| Solubility in water: 22.3 g/100 mL (25°C). | |
| OCC1OC2OC3C(CO)OC(OC4C(CO)OC(OC5C(CO)OC(OC6C(CO)OC(OC7C(CO)OC(OC8C(CO)OC(OC9C(CO)OC(OC1C(O)C2O)C(O)C9O)C(O)C8O)C(O)C7O)C(O)C6O)C(O)C5O)C(O)C4O)C(O)C3O | |
| 1297.13 | |
| 1297.15 | |
| Powder |
| 91464-90-3 | |
| White | |
| 98.5% min. (ELSD) (HPLC) | |
| C48H80O40 | |
| 5 g | |
| + 177.00 (20.00°C c=1,H2O) | |
| gamma-cyclodextrin hydrate, 1297.12 anhydrous, gamma-cyclodextrin hydrate, vetec tm reagent grade | |
| GDSRMADSINPKSL-UHFFFAOYNA-N | |
| 5,10,15,20,25,30,35,40-octakis(hydroxymethyl)-2,4,7,9,12,14,17,19,22,24,27,29,32,34,37,39-hexadecaoxanonacyclo[36.2.2.2³,â¶.2â¸,¹¹.2¹³,¹â¶.2¹â¸,²¹.2²³,²â¶.2²â¸,³¹.2³³,³â¶]hexapentacontane-41,42,43,44,45,46,47,48,49,50,51,52,53,54,55,56-hexadecol | |
| 71311509 | |
| 99% |
Chemical Identifiers
| 91464-90-3 | |
| 1297.13 | |
| GDSRMADSINPKSL-UHFFFAOYNA-N | |
| 71311509 | |
| OCC1OC2OC3C(CO)OC(OC4C(CO)OC(OC5C(CO)OC(OC6C(CO)OC(OC7C(CO)OC(OC8C(CO)OC(OC9C(CO)OC(OC1C(O)C2O)C(O)C9O)C(O)C8O)C(O)C7O)C(O)C6O)C(O)C5O)C(O)C4O)C(O)C3O |
| C48H80O40 | |
| MFCD00149574 | |
| gamma-cyclodextrin hydrate, 1297.12 anhydrous, gamma-cyclodextrin hydrate, vetec tm reagent grade | |
| 5,10,15,20,25,30,35,40-octakis(hydroxymethyl)-2,4,7,9,12,14,17,19,22,24,27,29,32,34,37,39-hexadecaoxanonacyclo[36.2.2.2³,â¶.2â¸,¹¹.2¹³,¹â¶.2¹â¸,²¹.2²³,²â¶.2²â¸,³¹.2³³,³â¶]hexapentacontane-41,42,43,44,45,46,47,48,49,50,51,52,53,54,55,56-hexadecol |
RUO – Research Use Only