missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Creatine phosphate disodium salt tetrahydrate, 99%
CAS: 71519-72-7 | C4H8N3Na2O5P | 255.08 g/mol
Supplier: Thermo Scientific Chemicals 337340010
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Creatine phosphate disodium salt tetrahydrate | |
| White | |
| 99% | |
| C4H8N3Na2O5P | |
| MFCD00150192 | |
| creatine phosphate sodium salt | |
| RNTXMYSPASRLFT-UHFFFAOYSA-L | |
| disodium tetrahydrate ({amino[(carboxymethyl)(methyl)amino]methylidene}amino)phosphonate | |
| 91884830 | |
| 99% |
| 71519-72-7 | |
| Authentic | |
| Glass bottle | |
| Na2O3PNHC(NH)N(CH3)CH2COOH·4H2O | |
| 1 g | |
| (10% in water) Clear colorless solution | |
| [Na+].[Na+].CN(CC(O)=O)C(N)=NP([O-])([O-])=O | |
| 255.08 | |
| 327.14 | |
| Powder |
Chemical Identifiers
| 71519-72-7 | |
| 255.08 | |
| RNTXMYSPASRLFT-UHFFFAOYSA-L | |
| 91884830 |
| C4H8N3Na2O5P | |
| MFCD00150192 | |
| creatine phosphate sodium salt | |
| [Na+].[Na+].CN(CC(O)=O)C(N)=NP([O-])([O-])=O |
RUO – Research Use Only