missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Coumarin-3-carboxylic Acid 98.0+%, TCI America™
Supplier: TCI America C312925G
Specifications
| Coumarin-3-carboxylic Acid | |
| 192°C | |
| MFCD00006852 | |
| 2811 | |
| ACMLKANOGIVEPB-UHFFFAOYSA-N | |
| 2-oxochromene-3-carboxylic acid | |
| 10752 | |
| ≥98.0% (GC,T) |
| 531-81-7 | |
| C10H6O4 | |
| 25 g | |
| coumarin-3-carboxylic acid, 2-oxo-2h-chromene-3-carboxylic acid, 3-carboxycoumarin, 2-oxobenzopyran-3-carboxylic acid, g 1 rodenticide, 2h-1-benzopyran-3-carboxylic acid, 2-oxo, 2-oxo-2h-1-benzopyran-3-carboxylic acid, unii-v85uov8788, g 1 the rodenticide van, g 1 van | |
| C1=CC=C2C(=C1)C=C(C(=O)O2)C(=O)O | |
| 190.154 | |
| 190.15 | |
| Crystalline Powder |
Chemical Identifiers
| 531-81-7 | |
| 190.154 | |
| ACMLKANOGIVEPB-UHFFFAOYSA-N | |
| 10752 | |
| C1=CC=C2C(=C1)C=C(C(=O)O2)C(=O)O |
| C10H6O4 | |
| MFCD00006852 | |
| coumarin-3-carboxylic acid, 2-oxo-2h-chromene-3-carboxylic acid, 3-carboxycoumarin, 2-oxobenzopyran-3-carboxylic acid, g 1 rodenticide, 2h-1-benzopyran-3-carboxylic acid, 2-oxo, 2-oxo-2h-1-benzopyran-3-carboxylic acid, unii-v85uov8788, g 1 the rodenticide van, g 1 van | |
| 2-oxochromene-3-carboxylic acid |
Safety and Handling
RTECSNumber : DJ2490000
TSCA : No