missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Coenzyme Q10, 98%
CAS: 303-98-0 | C59H90O4 | 863.37 g/mol
$113.83 - $959.86
Chemical Identifiers
| CAS | 303-98-0 |
|---|---|
| Molecular Formula | C59H90O4 |
| Molecular Weight (g/mol) | 863.37 |
| MDL Number | MFCD00042919 |
| InChI Key | ACTIUHUUMQJHFO-UPTCCGCDSA-N |
| Synonym | coenzyme q10, ubidecarenone, ubiquinone 50, coq10, ubiquinone-10, neuquinon, ubiquinone, justquinon, neuquinone, emitolon |
| PubChem CID | 5281915 |
| ChEBI | CHEBI:46245 |
| SMILES | COC1=C(OC)C(=O)C(C\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)=C(C)C1=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC457950010
|
Thermo Scientific Chemicals
457950010 |
1 g |
Each for $113.83
|
|
|||||
|
AC457950250
|
Thermo Scientific Chemicals
457950250 |
25 g |
Each for $959.86
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 303-98-0 | |
| 863.37 | |
| ACTIUHUUMQJHFO-UPTCCGCDSA-N | |
| 5281915 | |
| COC1=C(OC)C(=O)C(C\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)=C(C)C1=O |
| C59H90O4 | |
| MFCD00042919 | |
| coenzyme q10, ubidecarenone, ubiquinone 50, coq10, ubiquinone-10, neuquinon, ubiquinone, justquinon, neuquinone, emitolon | |
| CHEBI:46245 |
Specifications
| 303-98-0 | |
| Authentic | |
| Glass Bottle | |
| MFCD00042919 | |
| coenzyme q10, ubidecarenone, ubiquinone 50, coq10, ubiquinone-10, neuquinon, ubiquinone, justquinon, neuquinone, emitolon | |
| ACTIUHUUMQJHFO-UPTCCGCDSA-N | |
| 2-[(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaenyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione | |
| 5281915 | |
| 863.37 | |
| Coenzyme Q10 |
| 49.0°C | |
| 97.5% min. (HPLC) | |
| C59H90O4 | |
| 1 g | |
| Solubility in water: insoluble. Other solubilities: soluble in ether and ethanol | |
| COC1=C(OC)C(=O)C(C\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)=C(C)C1=O | |
| 863.37 | |
| CHEBI:46245 | |
| 98% |
Safety and Handling
EINECSNumber : 206-147-9
RUO – Research Use Only