missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Citric Acid, Certified, 10.0% (w/v) ±0.5% (w/v), LabChem™
Supplier: LabChem LC131502
Specifications
| Citric Acid | |
| 90,10 | |
| C6H8O7 | |
| MFCD00011669 | |
| Soluble in water | |
| OC(=O)CC(O)(CC(O)=O)C(O)=O | |
| 192.12 | |
| CHEBI:30769 | |
| 10.0% ±0.5% (w/v) | |
| 1 L | |
| Liquid |
| 77-92-9,7732-18-5 | |
| Colorless | |
| C6H8O7 | |
| citric acid, citric acid, anhydrous, citro, anhydrous citric acid, citrate, aciletten, citretten, chemfill, hydrocerol a, 1,2,3-propanetricarboxylic acid, 2-hydroxy | |
| KRKNYBCHXYNGOX-UHFFFAOYSA-N | |
| 2-hydroxypropane-1,2,3-tricarboxylic acid | |
| 311 | |
| 192.12 | |
| Certified | |
| Poly Bottle | |
| Traceable to NIST |
Chemical Identifiers
| 77-92-9 | |
| 192.12 | |
| KRKNYBCHXYNGOX-UHFFFAOYSA-N | |
| 311 | |
| 2-hydroxypropane-1,2,3-tricarboxylic acid |
| C6H8O7 | |
| MFCD00011669 | |
| citric acid, citric acid, anhydrous, citro, anhydrous citric acid, citrate, aciletten, citretten, chemfill, hydrocerol a, 1,2,3-propanetricarboxylic acid, 2-hydroxy | |
| CHEBI:30769 | |
| OC(=O)CC(O)(CC(O)=O)C(O)=O |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
GHS P Statement
Wear protective gloves, eye protection.
Wash exposed skin thoroughly after handling.
If in eyes: Rinse cautiously with water for several minutes.
Remove contact lenses, if present and easy to do.
Continue rinsing.
If eye irritation persists: Get medical advice/attention.
Warning
Recommended Storage : Room Temperature