missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Citric acid, ≥99.5%, ACS reagent, anhydrous
CAS: 77-92-9 | C6H8O7 | 192.12 g/mol
$142.09 - $384.26
Chemical Identifiers
| CAS | 77-92-9 |
|---|---|
| Molecular Formula | C6H8O7 |
| Molecular Weight (g/mol) | 192.12 |
| MDL Number | MFCD00011669 |
| InChI Key | KRKNYBCHXYNGOX-UHFFFAOYSA-N |
| Synonym | citric acid, citric acid, anhydrous, citro, anhydrous citric acid, citrate, aciletten, citretten, chemfill, hydrocerol a, 1,2,3-propanetricarboxylic acid, 2-hydroxy |
| PubChem CID | 311 |
| ChEBI | CHEBI:30769 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | OC(=O)CC(O)(CC(O)=O)C(O)=O |
| Catalog Number | Mfr. No. | Quantity | Price | Qty | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Qty | |||||
|
AC423565000
|
Thermo Scientific Chemicals
423565000 |
500 g |
Each for $142.09
Case of 6 Each for $0.00
|
|
|||||
|
AC423560020
|
Thermo Scientific Chemicals
423560020 |
2 kg |
Each for $384.26
Case of 6 Each for $0.00
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 77-92-9 | |
| 192.12 | |
| KRKNYBCHXYNGOX-UHFFFAOYSA-N | |
| 311 | |
| 2-hydroxypropane-1,2,3-tricarboxylic acid |
| C6H8O7 | |
| MFCD00011669 | |
| citric acid, citric acid, anhydrous, citro, anhydrous citric acid, citrate, aciletten, citretten, chemfill, hydrocerol a, 1,2,3-propanetricarboxylic acid, 2-hydroxy | |
| CHEBI:30769 | |
| OC(=O)CC(O)(CC(O)=O)C(O)=O |
Specifications
| 153.0°C | |
| C6H8O7 | |
| MFCD00011669 | |
| Solubility in water: 750g/L (20°C). Other solubilities: soluble in alcohol and ether, badly soluble in diethyl ether, insoluble in benzene and chloroform | |
| OC(=O)CC(O)(CC(O)=O)C(O)=O | |
| 192.12 | |
| CHEBI:30769 | |
| 99.6% | |
| 500 g | |
| Citric acid |
| 77-92-9 | |
| HO2CCH2C(OH)(CO2H)CH2CO2H | |
| citric acid, citric acid, anhydrous, citro, anhydrous citric acid, citrate, aciletten, citretten, chemfill, hydrocerol a, 1,2,3-propanetricarboxylic acid, 2-hydroxy | |
| KRKNYBCHXYNGOX-UHFFFAOYSA-N | |
| 2-hydroxypropane-1,2,3-tricarboxylic acid | |
| 311 | |
| 192.13 | |
| ACS Reagent | |
| 100°C |
RUO – Research Use Only