missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals cis-4,7,10,13,16,19-Docosahexaenoic acid, 98%
CAS: 6217-54-5 | C22H32O2 | 328.49 g/mol
Supplier: Thermo Scientific Chemicals 427641000
| Quantity | 100 mg |
|---|---|
| Packaging | Glass Bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| C22H32O2 | |
| MBMBGCFOFBJSGT-OBOJEMQYSA-N | |
| (4E,7E,10E,13E,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoic acid |
Specifications
| cis-4,7,10,13,16,19-Docosahexaenoic acid | |
| -44°C | |
| 0.9500g/mL | |
| Authentic | |
| Glass Bottle | |
| CH3(CH2CHCH)6CH2CH2COOH | |
| 0.95 | |
| cis-4,7,10,13,16,19-docosahexaenoic acid, 4,7,10,13,16,19-cis-docosahexaenoic acid, cis-4, 7, 10, 13, 16, 19-docosahexaenoic acid, 4z-docosa-4,7,10,13,16,19-hexaenoic acid | |
| CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)O | |
| 328.49 | |
| 328.49 | |
| Oil |
| 6217-54-5 | |
| Colorless to Yellow | |
| 62°C | |
| 97.5% min. (GC) | |
| C22H32O2 | |
| 100 mg | |
| 15, 3443 | |
| MBMBGCFOFBJSGT-OBOJEMQYSA-N | |
| (4E,7E,10E,13E,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoic acid | |
| 57417355 | |
| 98% |