missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Choline bitatrate, >98%, MP Biomedicals™
$223.75 - $223.75
Chemical Identifiers
| CAS | 87-67-2 |
|---|---|
| Molecular Formula | C9H19NO7 |
| Molecular Weight (g/mol) | 253.251 |
| MDL Number | MFCD00036332 |
| InChI Key | QWJSAWXRUVVRLH-UHFFFAOYSA-M |
| Synonym | choline bitartrate, cholini bitartras, choline 3-carboxy-2,3-dihydroxypropanoate, 2-hydroxyethyl trimethylammonium bitartrate, choline tartrate 1:1, 2-hydroxy-n,n,n-trimethylethanaminium 3-carboxy-2,3-dihydroxypropanoate, cholinibitatratis, choline hydrogen l-+-tartrate, ethanaminium, 2-hydroxy-n,n,n-trimethyl-, 2r,3r-2,3-dihydroxybutanedioate 1:1 |
| PubChem CID | 10198924 |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;2,3,4-trihydroxy-4-oxobutanoate |
| SMILES | C[N+](C)(C)CCO.C(C(C(=O)[O-])O)(C(=O)O)O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
ICN10138490
|
MP Biomedicals Inc
0210138490 |
500 g |
Each for $223.75
|
|
|||||
Chemical Identifiers
| 87-67-2 | |
| 253.251 | |
| QWJSAWXRUVVRLH-UHFFFAOYSA-M | |
| 10198924 | |
| C[N+](C)(C)CCO.C(C(C(=O)[O-])O)(C(=O)O)O |
| C9H19NO7 | |
| MFCD00036332 | |
| choline bitartrate, cholini bitartras, choline 3-carboxy-2,3-dihydroxypropanoate, 2-hydroxyethyl trimethylammonium bitartrate, choline tartrate 1:1, 2-hydroxy-n,n,n-trimethylethanaminium 3-carboxy-2,3-dihydroxypropanoate, cholinibitatratis, choline hydrogen l-+-tartrate, ethanaminium, 2-hydroxy-n,n,n-trimethyl-, 2r,3r-2,3-dihydroxybutanedioate 1:1 | |
| 2-hydroxyethyl(trimethyl)azanium;2,3,4-trihydroxy-4-oxobutanoate |
Specifications
| 87-67-2 | |
| >98% | |
| MFCD00036332 | |
| choline bitartrate, cholini bitartras, choline 3-carboxy-2,3-dihydroxypropanoate, 2-hydroxyethyl trimethylammonium bitartrate, choline tartrate 1:1, 2-hydroxy-n,n,n-trimethylethanaminium 3-carboxy-2,3-dihydroxypropanoate, cholinibitatratis, choline hydrogen l-+-tartrate, ethanaminium, 2-hydroxy-n,n,n-trimethyl-, 2r,3r-2,3-dihydroxybutanedioate 1:1 | |
| C[N+](C)(C)CCO.C(C(C(=O)[O-])O)(C(=O)O)O | |
| 253.251 | |
| 253.3 | |
| Choline bitatrate, Molecular biology; Cell biology |
| White | |
| C9H19NO7 | |
| 500 g | |
| QWJSAWXRUVVRLH-UHFFFAOYSA-M | |
| 2-hydroxyethyl(trimethyl)azanium;2,3,4-trihydroxy-4-oxobutanoate | |
| 10198924 | |
| Powder |
Safety and Handling
EINECSNumber : 201-763-4
Recommended Storage : Store at room temperature (15° to 30°C), desiccate.