missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Chlorogenic acid, 98%
CAS: 327-97-9 | C16H18O9 | 354.31 g/mol
$177.34 - $177.34
Chemical Identifiers
| CAS | 327-97-9 |
|---|---|
| Molecular Formula | C16H18O9 |
| Molecular Weight (g/mol) | 354.31 |
| MDL Number | MFCD00003862 |
| InChI Key | CWVRJTMFETXNAD-JUHZACGLSA-N |
| Synonym | chlorogenic acid, 3-caffeoylquinic acid, chlorogenate, 3-o-caffeoylquinic acid, 3-3,4-dihydroxycinnamoyl quinic acid, heriguard, hlorogenic acid, caffeoyl quinic acid, 3-caffeoylquinate, unii-318adp12ri |
| PubChem CID | 1794427 |
| ChEBI | CHEBI:16112 |
| IUPAC Name | (1S,3R,4R,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylic acid |
| SMILES | O[C@@H]1C[C@](O)(C[C@@H](OC(=O)\C=C\C2=CC=C(O)C(O)=C2)[C@@H]1O)C(O)=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC109240010
|
Thermo Scientific Chemicals
109240010 |
1 g | Glass bottle |
Each for $177.34
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 327-97-9 | |
| 354.31 | |
| CWVRJTMFETXNAD-JUHZACGLSA-N | |
| 1794427 | |
| (1S,3R,4R,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylic acid |
| C16H18O9 | |
| MFCD00003862 | |
| chlorogenic acid, 3-caffeoylquinic acid, chlorogenate, 3-o-caffeoylquinic acid, 3-3,4-dihydroxycinnamoyl quinic acid, heriguard, hlorogenic acid, caffeoyl quinic acid, 3-caffeoylquinate, unii-318adp12ri | |
| CHEBI:16112 | |
| O[C@@H]1C[C@](O)(C[C@@H](OC(=O)\C=C\C2=CC=C(O)C(O)=C2)[C@@H]1O)C(O)=O |
Specifications
| 327-97-9 | |
| White | |
| 97.5% min. (HPLC) | |
| C16H18O9 | |
| 1 g | |
| 15, 2143 | |
| chlorogenic acid, 3-caffeoylquinic acid, chlorogenate, 3-o-caffeoylquinic acid, 3-3,4-dihydroxycinnamoyl quinic acid, heriguard, hlorogenic acid, caffeoyl quinic acid, 3-caffeoylquinate, unii-318adp12ri | |
| CWVRJTMFETXNAD-JUHZACGLSA-N | |
| (1S,3R,4R,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylic acid | |
| 1794427 | |
| 354.3 | |
| Crystals, Powder, Needles or Chunks |
| 205.0°C to 209.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00003862 | |
| 10, I, 271 | |
| -36 | |
| Solubility in water: soluble in hot water. Other solubilities: soluble in alcohol and acetone | |
| O[C@@H]1C[C@](O)(C[C@@H](OC(=O)\C=C\C2=CC=C(O)C(O)=C2)[C@@H]1O)C(O)=O | |
| 354.31 | |
| CHEBI:16112 | |
| 98% | |
| Chlorogenic acid, Predominantly trans, From coffee seeds |
Safety and Handling
EINECSNumber : 206-325-6
RUO – Research Use Only