missing translation for 'onlineSavingsMsg'
Learn More
Learn More
![Chloranil (ca. 2% in N,N-Dimethylformamide) [for Detection of Primary and Secondary Amines], TCI America™](https://assets.fishersci.com/TFS-Assets/CCG/Chemical-Structures/chemical-structure-cas-118-75-2.jpg-650.jpg)
![Chloranil (ca. 2% in N,N-Dimethylformamide) [for Detection of Primary and Secondary Amines], TCI America™](https://assets.fishersci.com/TFS-Assets/CCG/TCI-America/logos/Rings Blue.jpg-650.jpg)
Chloranil (ca. 2% in N,N-Dimethylformamide) [for Detection of Primary and Secondary Amines], TCI America™
Supplier: TCI America C177010ML
Specifications
| Chloranil (ca. 2% in N,N-Dimethylformamide) [for Detection of Primary and Secondary Amines] | |
| C6Cl4O2 | |
| 10 mL | |
| chloranil, p-chloranil, tetrachloro-p-benzoquinone, tetrachloro-1,4-benzoquinone, tetrachlorobenzoquinone, spergon, coversan, reranil, vulklor, 2,3,5,6-tetrachloro-1,4-benzoquinone | |
| ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O | |
| 245.86 | |
| CHEBI:36703 | |
| Liquid |
| 118-75-2 | |
| MFCD00001594 | |
| 2265 | |
| UGNWTBMOAKPKBL-UHFFFAOYSA-N | |
| tetrachlorocyclohexa-2,5-diene-1,4-dione | |
| 8371 | |
| 245.86 |
Chemical Identifiers
| 118-75-2 | |
| 245.86 | |
| UGNWTBMOAKPKBL-UHFFFAOYSA-N | |
| 8371 | |
| tetrachlorocyclohexa-2,5-diene-1,4-dione |
| C6Cl4O2 | |
| MFCD00001594 | |
| chloranil, p-chloranil, tetrachloro-p-benzoquinone, tetrachloro-1,4-benzoquinone, tetrachlorobenzoquinone, spergon, coversan, reranil, vulklor, 2,3,5,6-tetrachloro-1,4-benzoquinone | |
| CHEBI:36703 | |
| ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O |
Safety and Handling
EINECSNumber : (3)-1007
RTECSNumber : DK6825000
TSCA : Yes