missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Chalcone, 97%
CAS: 94-41-7 | C15H12O | 208.26 g/mol
Supplier: Thermo Scientific Chemicals 159435000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Chalcone | |
| 94-41-7 | |
| Yellow | |
| >112°C | |
| 96% min. (GC) | |
| C15H12O | |
| MFCD00003082 | |
| 07, 478 | |
| chalcone, trans-chalcone, e-chalcone, benzalacetophenone, chalkone, benzylideneacetophenone, phenyl styryl ketone, cinnamophenone, 2-benzalacetophenone, 2-benzylideneacetophenone | |
| DQFBYFPFKXHELB-VAWYXSNFSA-N | |
| (E)-1,3-diphenylprop-2-en-1-one | |
| 637760 | |
| 208.26 | |
| Granular Powder |
| 97% | |
| 53.0°C to 58.0°C | |
| 345.0°C to 348.0°C | |
| Authentic | |
| Plastic bottle | |
| C6H5CH=CHCOC6H5 | |
| 500 g | |
| 15, 2036 | |
| Solubility in water: insoluble. Other solubilities: freely soluble in ether,chloroform,benzene and,carbon disulfide,slightly soluble in alcohol | |
| O=C(\C=C\C1=CC=CC=C1)C1=CC=CC=C1 | |
| 208.26 | |
| CHEBI:48965 | |
| 97% |
Chemical Identifiers
| 94-41-7 | |
| 208.26 | |
| DQFBYFPFKXHELB-VAWYXSNFSA-N | |
| 637760 | |
| O=C(\C=C\C1=CC=CC=C1)C1=CC=CC=C1 |
| C15H12O | |
| MFCD00003082 | |
| chalcone, trans-chalcone, e-chalcone, benzalacetophenone, chalkone, benzylideneacetophenone, phenyl styryl ketone, cinnamophenone, 2-benzalacetophenone, 2-benzylideneacetophenone | |
| CHEBI:48965 |
Safety and Handling
EINECSNumber : 202-330-2
RTECSNumber : FL6900000
TSCA : TSCA
RUO – Research Use Only