missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Castor oil, specified according to the requirements of Ph.Eur.
CAS: 8001-79-4 | C57H104O9 | 933.45 g/mol
Supplier: Thermo Scientific Chemicals 348850025
| Quantity | 2.5 L |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 8001-79-4 | |
| 933.45 | |
| ZEMPKEQAKRGZGQ-AAKVHIHISA-N | |
| 14030006 | |
| CCCCCCC(CC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCC(CCCCCC)O)OC(=O)CCCCCCCC=CCC(CCCCCC)O)O |
| C57H104O9 | |
| MFCD00130746 | |
| castor oil, ricinus oil, olio di ricino, venelex, xenaderm, optase, trypsin complex, unii-d5340y2i9g, castor oil usp:jan, 1-o,2-o,3-o-tris z-12-hydroxy-9-octadecenoyl glycerol | |
| 2,3-bis[[(Z)-12-hydroxyoctadec-9-enoyl]oxy]propyl (Z)-12-hydroxyoctadec-9-enoate |
Specifications
| Castor oil | |
| 8001-79-4 | |
| -10.0°C | |
| 0.9570g/mL | |
| 229°C | |
| Glass bottle | |
| 1.4770 to 1.4810 | |
| MFCD00130746 | |
| 0.957 | |
| + 3.50 | |
| Solubility in water: .. Other solubilities: miscible with alcohol, benzene, chloroform,, carbondisulfide, ether and glacial acetic acid | |
| CCCCCCC(CC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCC(CCCCCC)O)OC(=O)CCCCCCCC=CCC(CCCCCC)O)O | |
| 933.45 | |
| 0,6-0,8 Pas (25°C) | |
| of fatty acids (GC): Passes Test (per Eur. Pharm.) |
| 2.0mg KOH/g max. | |
| 1.5 max. (at the absorption maximum at 269 +/- 1nm) | |
| Colorless or Yellow | |
| 229.0°C | |
| Authentic | |
| C57H104O9 | |
| 2.5 L | |
| 14,1898 | |
| + 3.50 (20.00°C c=neat) | |
| castor oil, ricinus oil, olio di ricino, venelex, xenaderm, optase, trypsin complex, unii-d5340y2i9g, castor oil usp:jan, 1-o,2-o,3-o-tris z-12-hydroxy-9-octadecenoyl glycerol | |
| ZEMPKEQAKRGZGQ-AAKVHIHISA-N | |
| 2,3-bis[[(Z)-12-hydroxyoctadec-9-enoyl]oxy]propyl (Z)-12-hydroxyoctadec-9-enoate | |
| 14030006 | |
| Eu. Ph. | |
| Viscous Hygroscopic Liquid |
Safety and Handling
EINECSNumber : 232-293-8
RTECSNumber : FI4100000
TSCA : TSCA